The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S)-2-[[(2S)-1-[[5-(dimethylamino)-1-naphthyl]sulfonyl]piperidine-2-carbonyl]amino]-4-phenyl-butanoic acid 2,2,2-trifluoroacetic acid ID: ALA4640735
PubChem CID: 156015454
Max Phase: Preclinical
Molecular Formula: C30H34F3N3O7S
Molecular Weight: 523.66
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)c1cccc2c(S(=O)(=O)N3CCCC[C@H]3C(=O)N[C@@H](CCc3ccccc3)C(=O)O)cccc12.O=C(O)C(F)(F)F
Standard InChI: InChI=1S/C28H33N3O5S.C2HF3O2/c1-30(2)24-15-8-13-22-21(24)12-9-16-26(22)37(35,36)31-19-7-6-14-25(31)27(32)29-23(28(33)34)18-17-20-10-4-3-5-11-20;3-2(4,5)1(6)7/h3-5,8-13,15-16,23,25H,6-7,14,17-19H2,1-2H3,(H,29,32)(H,33,34);(H,6,7)/t23-,25-;/m0./s1
Standard InChI Key: NVAYRMDHOYAFPB-CWAVIJBDSA-N
Molfile:
RDKit 2D
44 46 0 0 0 0 0 0 0 0999 V2000
17.4148 -9.1893 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.1226 -8.7818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1226 -7.9623 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.8307 -9.1894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5387 -8.7818 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
18.8307 -10.0089 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
19.5387 -9.6012 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.6177 -8.7488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3255 -8.3371 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.0373 -8.7488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0373 -9.5637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3255 -9.9754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6177 -9.5637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7448 -8.3373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7448 -7.5186 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4522 -8.7488 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.1597 -8.3373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8712 -8.7488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5787 -8.3373 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.8712 -9.5634 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1597 -7.5186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8712 -7.1113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8712 -6.2926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1598 -5.8808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1608 -5.0656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8727 -4.6581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5762 -5.0606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5789 -5.8786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3255 -7.5184 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.6180 -7.1111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9104 -7.5182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2024 -7.1117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2024 -6.2926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9078 -5.8821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6180 -6.2874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4934 -7.5190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4952 -8.3335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1994 -8.7389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9085 -8.3298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7859 -7.1117 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0786 -7.5190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7859 -6.2930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1464 -7.5184 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7339 -6.8116 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 1 0
4 5 1 0
4 6 1 0
4 7 1 0
8 9 1 0
10 9 1 0
11 10 1 0
12 11 1 0
13 12 1 0
8 13 1 0
10 14 1 6
14 15 2 0
14 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
18 20 2 0
17 21 1 1
21 22 1 0
22 23 1 0
24 23 2 0
25 24 1 0
26 25 2 0
27 26 1 0
28 27 2 0
23 28 1 0
9 29 1 0
29 30 1 0
31 30 2 0
32 31 1 0
33 32 2 0
34 33 1 0
35 34 2 0
30 35 1 0
32 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
31 39 1 0
36 40 1 0
40 41 1 0
40 42 1 0
29 43 2 0
29 44 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 523.66Molecular Weight (Monoisotopic): 523.2141AlogP: 3.65#Rotatable Bonds: 9Polar Surface Area: 107.02Molecular Species: ACIDHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.58CX Basic pKa: 4.67CX LogP: 3.01CX LogD: 0.90Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.44Np Likeness Score: -0.89
References 1. de la Sierra-Gallay IL, Belnou M, Chambraud B, Genet M, van Tilbeurgh H, Aumont-Nicaise M, Desmadril M, Baulieu EE, Jacquot Y, Byrne C.. (2020) Bioinspired Hybrid Fluorescent Ligands for the FK1 Domain of FKBP52., 63 (18): [PMID:32866001 ] [10.1021/acs.jmedchem.0c00825 ]