(R)-3-(5-amino-1,3,4-thiadiazol-2-ylthio)-2-hydroxy-3,4-dihydro-2H-benzo[e][1,2]oxaborinine-8-carboxylic acid

ID: ALA4640764

PubChem CID: 76900646

Max Phase: Preclinical

Molecular Formula: C11H10BN3O4S2

Molecular Weight: 323.16

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Nc1nnc(S[C@H]2Cc3cccc(C(=O)O)c3OB2O)s1

Standard InChI:  InChI=1S/C11H10BN3O4S2/c13-10-14-15-11(21-10)20-7-4-5-2-1-3-6(9(16)17)8(5)19-12(7)18/h1-3,7,18H,4H2,(H2,13,14)(H,16,17)/t7-/m0/s1

Standard InChI Key:  QFFKFXFQLMNMIU-ZETCQYMHSA-N

Molfile:  

 
     RDKit          2D

 21 23  0  0  0  0  0  0  0  0999 V2000
   21.6181  -19.0911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3278  -18.6817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3250  -17.8590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6164  -17.4537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9101  -18.6821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9142  -17.8626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2104  -17.4515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4980  -17.8555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4939  -18.6750    0.0000 B   0  0  0  0  0  0  0  0  0  0  0  0
   20.2022  -19.0906    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.6179  -19.9083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9101  -20.3167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.3256  -20.3171    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.7837  -19.0793    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.7929  -17.4423    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   18.0826  -17.8464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3413  -17.5060    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   16.7906  -18.1097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1947  -18.8201    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.9950  -18.6552    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.9784  -18.0191    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  2  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  1 11  1  0
 11 12  1  0
 11 13  2  0
  9 14  1  0
  8 15  1  1
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 16  2  0
 18 21  1  0
M  END

Associated Targets(non-human)

KPC-2 Beta-lactamase (208 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 323.16Molecular Weight (Monoisotopic): 323.0206AlogP: #Rotatable Bonds:
Polar Surface Area: Molecular Species: HBA: HBD:
#RO5 Violations: HBA (Lipinski): HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: CX LogD:
Aromatic Rings: Heavy Atoms: QED Weighted: Np Likeness Score:

References

1. Hecker SJ, Reddy KR, Lomovskaya O, Griffith DC, Rubio-Aparicio D, Nelson K, Tsivkovski R, Sun D, Sabet M, Tarazi Z, Parkinson J, Totrov M, Boyer SH, Glinka TW, Pemberton OA, Chen Y, Dudley MN..  (2020)  Discovery of Cyclic Boronic Acid QPX7728, an Ultrabroad-Spectrum Inhibitor of Serine and Metallo-β-lactamases.,  63  (14): [PMID:32150407] [10.1021/acs.jmedchem.9b01976]

Source