The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Pentyl (((((R)-1-((4-aminopyrimidin-2-yl)oxy)propan-2-yl)oxy)methyl)(phenoxy)phosphoryl)-L-valinate ID: ALA4640824
PubChem CID: 156016016
Max Phase: Preclinical
Molecular Formula: C24H37N4O6P
Molecular Weight: 508.56
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCOC(=O)[C@@H](NP(=O)(CO[C@H](C)COc1nccc(N)n1)Oc1ccccc1)C(C)C
Standard InChI: InChI=1S/C24H37N4O6P/c1-5-6-10-15-31-23(29)22(18(2)3)28-35(30,34-20-11-8-7-9-12-20)17-33-19(4)16-32-24-26-14-13-21(25)27-24/h7-9,11-14,18-19,22H,5-6,10,15-17H2,1-4H3,(H,28,30)(H2,25,26,27)/t19-,22+,35?/m1/s1
Standard InChI Key: QNGHFZIGFMWRBF-UWWHPHPLSA-N
Molfile:
RDKit 2D
35 36 0 0 0 0 0 0 0 0999 V2000
2.3694 -3.3166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3682 -4.1440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0830 -4.5568 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7994 -4.1435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7966 -3.3129 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0812 -2.9039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0787 -2.0789 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5146 -4.5549 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5159 -5.3799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2309 -5.7912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2323 -6.6162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9448 -5.3776 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6599 -5.7889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3737 -5.3753 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
8.0888 -5.7867 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.3724 -4.5503 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3665 -6.1999 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8026 -5.3731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5178 -5.7845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2315 -5.3709 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5190 -6.6095 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6573 -4.1390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6578 -3.3144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9436 -2.9031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2287 -3.3169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2328 -4.1461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9475 -4.5536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9467 -5.7823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6604 -5.3687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3756 -5.7800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0894 -5.3663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8013 -4.5481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5151 -4.1345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0862 -4.1367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8045 -5.7777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
4 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
10 12 1 6
12 13 1 0
13 14 1 0
14 15 1 0
14 16 1 0
14 17 2 0
15 18 1 0
18 19 1 0
19 20 1 0
19 21 2 0
16 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
20 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
18 32 1 1
32 33 1 0
32 34 1 0
31 35 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 508.56Molecular Weight (Monoisotopic): 508.2451AlogP: 4.42#Rotatable Bonds: 16Polar Surface Area: 134.89Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.34CX Basic pKa: 5.85CX LogP: 4.26CX LogD: 4.25Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.19Np Likeness Score: -0.25
References 1. Luo M, Groaz E, Snoeck R, Andrei G, Herdewijn P.. (2020) Amidate Prodrugs of O -2-Alkylated Pyrimidine Acyclic Nucleosides Display Potent Anti-Herpesvirus Activity., 11 (7): [PMID:32676147 ] [10.1021/acsmedchemlett.0c00090 ]