rac-1-((9H-carbazol-4-yl)oxy)-3-(([1,1'-biphenyl]-4-ylmethyl)amino)propan-2-ol

ID: ALA4640999

PubChem CID: 156015883

Max Phase: Preclinical

Molecular Formula: C28H26N2O2

Molecular Weight: 422.53

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  OC(CNCc1ccc(-c2ccccc2)cc1)COc1cccc2[nH]c3ccccc3c12

Standard InChI:  InChI=1S/C28H26N2O2/c31-23(18-29-17-20-13-15-22(16-14-20)21-7-2-1-3-8-21)19-32-27-12-6-11-26-28(27)24-9-4-5-10-25(24)30-26/h1-16,23,29-31H,17-19H2

Standard InChI Key:  MZJRCUVNSQPNBZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   39.9871  -27.3712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9871  -26.5454    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.8564  -26.5329    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.4175  -26.5454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7002  -26.1325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1390  -26.1325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4301  -27.3712    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.7044  -28.6099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7044  -27.7841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9912  -29.0227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2735  -28.6099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2780  -27.7841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4867  -28.8607    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.0050  -28.1900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4957  -27.5268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1667  -26.7724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3471  -26.6798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8577  -27.3478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1894  -28.0997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.5654  -26.1097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.2865  -26.5122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.2961  -27.3389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.0163  -27.7412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.7264  -27.3179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.7116  -26.4880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.9909  -26.0894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.4457  -27.7174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.4575  -28.5442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   47.1782  -28.9455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   47.8877  -28.5213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   47.8719  -27.6914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   47.1507  -27.2938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1 12  1  0
  2  1  1  0
  3  6  1  0
  4  5  1  0
  5  2  1  0
  6  4  1  0
  7  4  1  0
  8 10  2  0
  9  1  2  0
 10 11  1  0
  9  8  1  0
 11 12  2  0
 12 15  1  0
 14 13  1  0
 13 11  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
  3 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 24 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4640999

    ---

Associated Targets(Human)

SK-MEL-5 (47095 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SK-MEL-28 (48833 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
A-375 (9258 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 422.53Molecular Weight (Monoisotopic): 422.1994AlogP: 5.52#Rotatable Bonds: 8
Polar Surface Area: 57.28Molecular Species: BASEHBA: 3HBD: 3
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 8.61CX LogP: 5.31CX LogD: 4.08
Aromatic Rings: 5Heavy Atoms: 32QED Weighted: 0.31Np Likeness Score: -0.30

References

1. Chang Q, Long J, Hu L, Chen Z, Li Q, Hu G..  (2020)  Drug repurposing and rediscovery: Design, synthesis and preliminary biological evaluation of 1-arylamino-3-aryloxypropan-2-ols as anti-melanoma agents.,  28  (9): [PMID:32216987] [10.1016/j.bmc.2020.115404]

Source