Rhodocorane J

ID: ALA4641065

PubChem CID: 156015386

Max Phase: Preclinical

Molecular Formula: C14H20O3

Molecular Weight: 236.31

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC1=C/C(=C2\[C@H](C)CC[C@@H]2[C@H](C)CO)OC1=O

Standard InChI:  InChI=1S/C14H20O3/c1-8-4-5-11(10(3)7-15)13(8)12-6-9(2)14(16)17-12/h6,8,10-11,15H,4-5,7H2,1-3H3/b13-12-/t8-,10-,11-/m1/s1

Standard InChI Key:  CSVYJQZYIZFTCP-PNABEOTDSA-N

Molfile:  

 
     RDKit          2D

 18 19  0  0  0  0  0  0  0  0999 V2000
   30.6525   -5.7946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6584   -6.6131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9973   -7.0934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2498   -7.8706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0671   -7.8706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3195   -7.0934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2201   -6.8409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0502   -6.0416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6128   -7.3877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0966   -6.8409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8356   -7.1352    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.5840   -7.7963    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   31.3078   -5.3112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0493   -4.5346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2308   -4.5405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9836   -5.3208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.5248   -3.8700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7456   -3.8830    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  2  1  0
  1  2  2  0
  3  7  1  0
  7  8  1  0
  7  9  1  1
  6 10  1  6
  9 11  1  0
  3 12  1  1
  1 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  1  0
 16  1  1  0
 14 17  1  0
 15 18  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4641065

    ---

Associated Targets(non-human)

Rhodotorula glutinis (200 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 236.31Molecular Weight (Monoisotopic): 236.1412AlogP: 2.42#Rotatable Bonds: 2
Polar Surface Area: 46.53Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 2.15CX LogD: 2.15
Aromatic Rings: Heavy Atoms: 17QED Weighted: 0.75Np Likeness Score: 2.01

References

1. Sandargo B, Michehl M, Stadler M, Surup F..  (2020)  Antifungal Sesquiterpenoids, Rhodocoranes, from Submerged Cultures of the Wrinkled Peach Mushroom, Rhodotus palmatus.,  83  (3): [PMID:31820970] [10.1021/acs.jnatprod.9b00871]

Source