The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
rac-1-([1,1'-biphenyl]-4-yloxy)-3-(4-(pyridin-2-yl)piperazin-1-yl)propan-2-ol ID: ALA4641529
PubChem CID: 2940158
Max Phase: Preclinical
Molecular Formula: C24H27N3O2
Molecular Weight: 389.50
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: OC(COc1ccc(-c2ccccc2)cc1)CN1CCN(c2ccccn2)CC1
Standard InChI: InChI=1S/C24H27N3O2/c28-22(18-26-14-16-27(17-15-26)24-8-4-5-13-25-24)19-29-23-11-9-21(10-12-23)20-6-2-1-3-7-20/h1-13,22,28H,14-19H2
Standard InChI Key: LWUOYPKNHLJBKL-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
37.9899 -2.9791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9886 -3.8065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7035 -4.2193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4199 -3.8060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4170 -2.9754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7017 -2.5664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7051 -5.0422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9889 -5.4539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9883 -6.2781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7033 -6.6916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4202 -6.2748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4172 -5.4519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6992 -1.7414 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.4124 -1.3267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1281 -1.7371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1306 -2.5620 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.8413 -1.3224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5570 -1.7328 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.5595 -2.5578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.2702 -1.3182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.9860 -1.7285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.9884 -2.5535 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.7041 -2.9639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.2752 -2.9682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.7034 -3.7885 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
44.4182 -4.1988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.1324 -3.7842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.1273 -2.9549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.4119 -2.5484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
3 7 1 0
6 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
15 17 1 0
17 18 1 0
18 19 1 0
18 20 1 0
20 21 1 0
19 24 1 0
21 22 1 0
22 23 1 0
22 24 1 0
23 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 23 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 389.50Molecular Weight (Monoisotopic): 389.2103AlogP: 3.31#Rotatable Bonds: 7Polar Surface Area: 48.83Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.23CX LogP: 3.97CX LogD: 3.74Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.67Np Likeness Score: -1.46
References 1. Chang Q, Long J, Hu L, Chen Z, Li Q, Hu G.. (2020) Drug repurposing and rediscovery: Design, synthesis and preliminary biological evaluation of 1-arylamino-3-aryloxypropan-2-ols as anti-melanoma agents., 28 (9): [PMID:32216987 ] [10.1016/j.bmc.2020.115404 ]