The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(5-(3,6-dioxocyclohexa-1,4-dienyl)-2-(pyrrolidin-1-ylmethyl)phenyl)-4-(trifluoromethyl)benzenesulfonamide ID: ALA4641533
PubChem CID: 156016609
Max Phase: Preclinical
Molecular Formula: C24H21F3N2O4S
Molecular Weight: 490.50
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C1C=CC(=O)C(c2ccc(CN3CCCC3)c(NS(=O)(=O)c3ccc(C(F)(F)F)cc3)c2)=C1
Standard InChI: InChI=1S/C24H21F3N2O4S/c25-24(26,27)18-5-8-20(9-6-18)34(32,33)28-22-13-16(21-14-19(30)7-10-23(21)31)3-4-17(22)15-29-11-1-2-12-29/h3-10,13-14,28H,1-2,11-12,15H2
Standard InChI Key: CPUYNPDVBHBSKB-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
7.3457 -3.2708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7623 -3.9875 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.1746 -3.2683 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9069 -3.1666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9056 -3.9939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6205 -4.4068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3369 -3.9934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3340 -3.1630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6187 -2.7538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1944 -4.4036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4805 -3.9883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7678 -4.3967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7629 -5.2220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4768 -5.6373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1957 -5.2272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4831 -3.1633 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4734 -6.4623 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0470 -2.7478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0520 -4.4048 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0438 -1.9228 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7061 -1.4352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4482 -0.6515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6232 -0.6546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3713 -1.4401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4809 -4.4026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4775 -5.2260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1918 -5.6373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9066 -5.2237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9027 -4.3944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1878 -3.9868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6223 -5.6340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6247 -6.4590 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.3355 -5.2195 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.3332 -6.0457 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
10 11 1 0
10 15 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 1 0
5 10 1 0
11 16 2 0
14 17 2 0
8 18 1 0
7 19 1 0
18 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 20 1 0
19 2 1 0
2 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
28 31 1 0
31 32 1 0
31 33 1 0
31 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 490.50Molecular Weight (Monoisotopic): 490.1174AlogP: 4.19#Rotatable Bonds: 6Polar Surface Area: 83.55Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.63CX Basic pKa: 6.18CX LogP: 4.25CX LogD: 4.19Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.61Np Likeness Score: -0.84
References 1. Hou Z, Min W, Zhang R, Niu A, Li Y, Cao L, Han J, Luo C, Yang P, Ding H.. (2020) Lead discovery, chemical optimization, and biological evaluation studies of novel histone methyltransferase SET7 small-molecule inhibitors., 30 (9): [PMID:32173197 ] [10.1016/j.bmcl.2020.127061 ]