O-((41S,13aS)-13a-ethyl-2,3,41,5,6,13a-hexahydro-1H-indolo[3,2,1-de]pyrido[3,2,1-ij][1,5]naphthyridin-12-yl)methyl 2,4-difluorophenylcarbamothioate

ID: ALA4641656

PubChem CID: 156016186

Max Phase: Preclinical

Molecular Formula: C27H27F2N3OS

Molecular Weight: 479.60

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC[C@@]12C=C(COC(=S)Nc3ccc(F)cc3F)n3c4c(c5ccccc53)CCN(CCC1)[C@H]42

Standard InChI:  InChI=1S/C27H27F2N3OS/c1-2-27-11-5-12-31-13-10-20-19-6-3-4-7-23(19)32(24(20)25(27)31)18(15-27)16-33-26(34)30-22-9-8-17(28)14-21(22)29/h3-4,6-9,14-15,25H,2,5,10-13,16H2,1H3,(H,30,34)/t25-,27+/m1/s1

Standard InChI Key:  PRNISMHDFBXXFI-VPUSJEBWSA-N

Molfile:  

 
     RDKit          2D

 35 40  0  0  0  0  0  0  0  0999 V2000
    9.1585  -15.7385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5860  -15.7385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8722  -15.3208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1585  -16.5656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4510  -17.7990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1649  -18.2084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8683  -16.9750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8786  -17.7954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5904  -18.1945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2964  -17.7776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2861  -16.9570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5697  -16.5535    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.4517  -16.9793    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7353  -18.2133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0186  -17.8006    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8904  -16.1643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3679  -15.4935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0255  -14.7467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2059  -14.6694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7299  -15.3452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0748  -16.0893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8621  -16.1443    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.8704  -18.6214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5826  -19.0419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3028  -18.2150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5861  -17.8022    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3037  -19.0420    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.8703  -18.2166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1542  -17.8012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4388  -18.2149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4393  -19.0427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1611  -19.4554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8735  -19.0393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1547  -16.9741    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.7241  -19.4580    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  4  2  0
  1  3  1  0
 12  2  1  0
  2  3  1  0
  7  4  1  0
 13  5  1  0
  5  6  2  0
  6  8  1  0
  7  8  1  0
  7 12  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 13  4  1  0
  1 17  1  0
 16 13  1  0
  5 14  1  0
 14 15  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
  7 22  1  6
  8 23  1  6
 23 24  1  0
 15 25  1  0
 25 26  1  0
 25 27  2  0
 26 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 29 34  1  0
 31 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4641656

    ---

Associated Targets(Human)

PDE1A Tclin Phosphodiesterase 1A (251 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 479.60Molecular Weight (Monoisotopic): 479.1843AlogP: 6.28#Rotatable Bonds: 4
Polar Surface Area: 29.43Molecular Species: ACIDHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 6.34CX Basic pKa: 7.17CX LogP: 5.47CX LogD: 5.39
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.45Np Likeness Score: -0.17

References

1. Pan BW, Shi Y, Li WC, Wang Q, Pan M, Wu Q, Fu HZ..  (2020)  Synthesis and biological evaluation of Vinpocetine derivatives.,  30  (2): [PMID:31859156] [10.1016/j.bmcl.2019.05.052]

Source