The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(5-(3,6-dioxocyclohexa-1,4-dienyl)-2-(pyrrolidin-1-ylmethyl)phenyl)butane-1-sulfonamide ID: ALA4641673
PubChem CID: 156016421
Max Phase: Preclinical
Molecular Formula: C21H26N2O4S
Molecular Weight: 402.52
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCCS(=O)(=O)Nc1cc(C2=CC(=O)C=CC2=O)ccc1CN1CCCC1
Standard InChI: InChI=1S/C21H26N2O4S/c1-2-3-12-28(26,27)22-20-13-16(19-14-18(24)8-9-21(19)25)6-7-17(20)15-23-10-4-5-11-23/h6-9,13-14,22H,2-5,10-12,15H2,1H3
Standard InChI Key: LAHBKUSJFKOODJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
20.3737 -3.3206 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.7904 -4.0373 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
21.2027 -3.3181 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.9349 -3.2164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9338 -4.0437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6485 -4.4566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3650 -4.0432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3621 -3.2128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6467 -2.8037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2226 -4.4534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5086 -4.0382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7960 -4.4465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7912 -5.2718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5051 -5.6871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2239 -5.2770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5112 -3.2132 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.5016 -6.5120 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.0750 -2.7976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0800 -4.4546 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.0718 -1.9726 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.7341 -1.4851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4762 -0.7014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6512 -0.7045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3993 -1.4901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5088 -4.4524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2235 -4.0401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9377 -4.4528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6523 -4.0406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
10 11 1 0
10 15 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 1 0
5 10 1 0
11 16 2 0
14 17 2 0
8 18 1 0
7 19 1 0
18 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 20 1 0
19 2 1 0
2 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 402.52Molecular Weight (Monoisotopic): 402.1613AlogP: 2.92#Rotatable Bonds: 8Polar Surface Area: 83.55Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.15CX Basic pKa: 6.26CX LogP: 2.89CX LogD: 2.85Aromatic Rings: 1Heavy Atoms: 28QED Weighted: 0.68Np Likeness Score: -0.56
References 1. Hou Z, Min W, Zhang R, Niu A, Li Y, Cao L, Han J, Luo C, Yang P, Ding H.. (2020) Lead discovery, chemical optimization, and biological evaluation studies of novel histone methyltransferase SET7 small-molecule inhibitors., 30 (9): [PMID:32173197 ] [10.1016/j.bmcl.2020.127061 ]