The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-methyl-N-(1-(2-((1-methyl-1H-pyrazol-5-yl)amino)benzoyl)piperidin-4-yl)-4-trifluoromethyl-benzamide ID: ALA4641704
PubChem CID: 156016449
Max Phase: Preclinical
Molecular Formula: C25H26F3N5O2
Molecular Weight: 485.51
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(C(=O)c1ccc(C(F)(F)F)cc1)C1CCN(C(=O)c2ccccc2Nc2ccnn2C)CC1
Standard InChI: InChI=1S/C25H26F3N5O2/c1-31(23(34)17-7-9-18(10-8-17)25(26,27)28)19-12-15-33(16-13-19)24(35)20-5-3-4-6-21(20)30-22-11-14-29-32(22)2/h3-11,14,19,30H,12-13,15-16H2,1-2H3
Standard InChI Key: AWSDDUNNGCDAHC-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
4.4285 -10.7652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2439 -10.7664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6508 -10.0619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2434 -9.3558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4249 -9.3586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0217 -10.0637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0200 -11.4731 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2028 -11.4732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6519 -11.4744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2428 -12.1818 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4691 -11.4751 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8735 -12.1845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6871 -12.1871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1001 -11.4816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6933 -10.7717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8735 -10.7675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7192 -10.8148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9420 -11.0675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9422 -11.8847 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7195 -12.1369 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9717 -12.9142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9173 -11.4853 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3227 -12.1949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3291 -10.7795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9108 -12.9007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1398 -12.1986 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0957 -12.8941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6840 -13.5991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0894 -14.3096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9108 -14.3108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3188 -13.6052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6785 -15.0160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8613 -15.0134 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.0848 -15.7250 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.2639 -15.7206 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 1 0
7 8 1 0
2 9 1 0
9 10 2 0
9 11 1 0
11 12 1 0
11 16 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
8 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 8 1 0
20 21 1 0
14 22 1 0
22 23 1 0
22 24 1 0
23 25 1 0
23 26 2 0
25 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 25 1 0
29 32 1 0
32 33 1 0
32 34 1 0
32 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 485.51Molecular Weight (Monoisotopic): 485.2039AlogP: 4.56#Rotatable Bonds: 5Polar Surface Area: 70.47Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 3.26CX LogP: 4.51CX LogD: 4.51Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.58Np Likeness Score: -1.90
References 1. Ji D, Zhang W, Xu Y, Zhang JJ.. (2020) Design, synthesis and biological evaluation of anthranilamide derivatives as potent SMO inhibitors., 28 (6): [PMID:32063403 ] [10.1016/j.bmc.2020.115354 ]