The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
tert-butyl 4-((3-amino-2',5'-dimethoxybiphenyl-4-yl)methyl)piperazine-1-carboxylate ID: ALA4641837
PubChem CID: 156017382
Max Phase: Preclinical
Molecular Formula: C24H33N3O4
Molecular Weight: 427.55
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(OC)c(-c2ccc(CN3CCN(C(=O)OC(C)(C)C)CC3)c(N)c2)c1
Standard InChI: InChI=1S/C24H33N3O4/c1-24(2,3)31-23(28)27-12-10-26(11-13-27)16-18-7-6-17(14-21(18)25)20-15-19(29-4)8-9-22(20)30-5/h6-9,14-15H,10-13,16,25H2,1-5H3
Standard InChI Key: SZEYWAVQUXZSHI-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
14.3655 -3.0459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3643 -3.8732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0792 -4.2861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7956 -3.8727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7927 -3.0422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0773 -2.6331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5026 -2.6283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2190 -3.0398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9314 -2.6254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9287 -1.7995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2076 -1.3899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4981 -1.8067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0748 -1.8080 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3591 -1.3977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0790 -5.1112 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.7933 -5.5238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6410 -1.3833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3576 -1.7922 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.3619 -2.6172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0700 -1.3760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7866 -1.7849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7908 -2.6098 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.0785 -3.0260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5074 -3.0187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5116 -3.8437 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.2198 -2.6026 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.9364 -3.0115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6487 -2.5953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9405 -3.8365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6462 -3.4209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6472 -3.0355 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
5 7 1 0
6 13 1 0
13 14 1 0
3 15 1 0
15 16 1 0
10 17 1 0
17 18 1 0
18 19 1 0
18 20 1 0
20 21 1 0
19 23 1 0
21 22 1 0
22 23 1 0
22 24 1 0
24 25 2 0
24 26 1 0
26 27 1 0
27 28 1 0
27 29 1 0
27 30 1 0
9 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 427.55Molecular Weight (Monoisotopic): 427.2471AlogP: 4.01#Rotatable Bonds: 5Polar Surface Area: 77.26Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 6.74CX LogP: 3.16CX LogD: 3.08Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.73Np Likeness Score: -0.86
References 1. Hou Z, Min W, Zhang R, Niu A, Li Y, Cao L, Han J, Luo C, Yang P, Ding H.. (2020) Lead discovery, chemical optimization, and biological evaluation studies of novel histone methyltransferase SET7 small-molecule inhibitors., 30 (9): [PMID:32173197 ] [10.1016/j.bmcl.2020.127061 ]