5-chloro-N2-[5-(4-methylpiperazin-1-yl)-2-pyridyl]-N4-[4-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine

ID: ALA4642078

PubChem CID: 155665816

Max Phase: Preclinical

Molecular Formula: C21H21ClF3N7

Molecular Weight: 463.89

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN1CCN(c2ccc(Nc3ncc(Cl)c(Nc4ccc(C(F)(F)F)cc4)n3)nc2)CC1

Standard InChI:  InChI=1S/C21H21ClF3N7/c1-31-8-10-32(11-9-31)16-6-7-18(26-12-16)29-20-27-13-17(22)19(30-20)28-15-4-2-14(3-5-15)21(23,24)25/h2-7,12-13H,8-11H2,1H3,(H2,26,27,28,29,30)

Standard InChI Key:  UWBCXDANPWJDRP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   21.7237  -13.4614    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   21.1510  -13.1318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1510  -12.3079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4363  -11.8918    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.7216  -12.3079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0052  -11.8936    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.2866  -12.3072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5699  -11.8988    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.8570  -12.3141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8570  -13.1382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1439  -13.5579    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.4261  -13.1470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7161  -13.5639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7161  -14.3920    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.1458  -14.7216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4336  -14.7989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1439  -14.3820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5778  -13.5508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2866  -13.1353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7216  -13.1318    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.4363  -13.5478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4363  -14.3725    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.7179  -14.7874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7179  -15.6113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9972  -16.0239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2844  -15.6085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5671  -16.0175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5671  -16.6806    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   16.9963  -15.6848    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   16.9927  -16.3479    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   18.2844  -14.7805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0051  -14.3720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  1  0
 16 17  1  0
 17 11  1  0
 10 18  1  0
 18 19  2  0
 19  7  1  0
  5 20  1  0
 20 21  2  0
 21  2  1  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  1  0
 27 29  1  0
 27 30  1  0
 26 31  1  0
 31 32  2  0
 32 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4642078

    ---

Associated Targets(Human)

CDK9 Tchem CDK9/Cyclin K (143 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 463.89Molecular Weight (Monoisotopic): 463.1499AlogP: 4.78#Rotatable Bonds: 5
Polar Surface Area: 69.21Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 11.64CX Basic pKa: 7.65CX LogP: 5.02CX LogD: 4.57
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.56Np Likeness Score: -1.75

References

1. Wang Y, Chen X, Yan Y, Zhu X, Liu M, Liu X..  (2020)  Discovery and SARs of 5-Chloro-N4-phenyl-N2-(pyridin-2-yl)pyrimidine-2,4-diamine Derivatives as Oral Available and Dual CDK 6 and 9 Inhibitors with Potent Antitumor Activity.,  63  (6): [PMID:32129996] [10.1021/acs.jmedchem.9b02121]

Source