The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
tert-butyl 4-(4-(3,6-dioxocyclohexa-1,4-dienyl)benzoyl)-2-methylpiperazine-1-carboxylate ID: ALA4642263
PubChem CID: 156016122
Max Phase: Preclinical
Molecular Formula: C23H26N2O5
Molecular Weight: 410.47
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC1CN(C(=O)c2ccc(C3=CC(=O)C=CC3=O)cc2)CCN1C(=O)OC(C)(C)C
Standard InChI: InChI=1S/C23H26N2O5/c1-15-14-24(11-12-25(15)22(29)30-23(2,3)4)21(28)17-7-5-16(6-8-17)19-13-18(26)9-10-20(19)27/h5-10,13,15H,11-12,14H2,1-4H3
Standard InChI Key: GPWNHEUTIXYCFV-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
27.9959 -17.4433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9947 -18.2706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7059 -18.6814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4228 -18.2701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4199 -17.4397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7041 -17.0286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2830 -18.6782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5686 -18.2650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8554 -18.6714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8505 -19.4966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5649 -19.9139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2843 -19.5018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5712 -17.4401 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.5615 -20.7388 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.1333 -17.0226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1303 -16.1976 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.8498 -17.4344 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.8529 -18.2593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5632 -17.0171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5694 -18.6669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2828 -18.2539 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.2797 -17.4290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9993 -18.6616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0024 -19.4865 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.7127 -18.2486 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.4250 -18.6563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1384 -18.2432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4281 -19.4812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1355 -19.0684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5725 -19.4919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 1 0
7 12 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 1 0
2 7 1 0
8 13 2 0
11 14 2 0
5 15 1 0
15 16 2 0
15 17 1 0
17 18 1 0
17 19 1 0
19 22 1 0
18 20 1 0
20 21 1 0
21 22 1 0
21 23 1 0
23 24 2 0
23 25 1 0
25 26 1 0
26 27 1 0
26 28 1 0
26 29 1 0
20 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 410.47Molecular Weight (Monoisotopic): 410.1842AlogP: 2.86#Rotatable Bonds: 2Polar Surface Area: 83.99Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.15CX LogD: 3.15Aromatic Rings: 1Heavy Atoms: 30QED Weighted: 0.70Np Likeness Score: -0.37
References 1. Hou Z, Min W, Zhang R, Niu A, Li Y, Cao L, Han J, Luo C, Yang P, Ding H.. (2020) Lead discovery, chemical optimization, and biological evaluation studies of novel histone methyltransferase SET7 small-molecule inhibitors., 30 (9): [PMID:32173197 ] [10.1016/j.bmcl.2020.127061 ]