(1S,2S)-2-[2-[4-(3-phenoxyphenyl)-7-oxabicyclo[2.2.1]heptan-1-yl]ethyl]cyclopropanecarboxylic acid

ID: ALA4642294

PubChem CID: 156016724

Max Phase: Preclinical

Molecular Formula: C24H26O4

Molecular Weight: 378.47

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(O)[C@H]1C[C@@H]1CCC12CCC(c3cccc(Oc4ccccc4)c3)(CC1)O2

Standard InChI:  InChI=1S/C24H26O4/c25-22(26)21-15-17(21)9-10-23-11-13-24(28-23,14-12-23)18-5-4-8-20(16-18)27-19-6-2-1-3-7-19/h1-8,16-17,21H,9-15H2,(H,25,26)/t17-,21-,23?,24?/m0/s1

Standard InChI Key:  SNDBIMFUTZHJHS-QQIMVSQYSA-N

Molfile:  

 
     RDKit          2D

 28 32  0  0  0  0  0  0  0  0999 V2000
   28.4541  -18.5622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1705  -18.1502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8831  -18.5617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8831  -19.3867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1730  -19.7981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4541  -19.3920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7417  -19.8046    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.0253  -19.3920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3127  -19.8042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5998  -19.3926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5998  -18.5672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3100  -18.1557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0253  -18.5619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1705  -17.3252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3851  -16.4724    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.1705  -15.6751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4539  -16.0877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4539  -16.9127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8870  -16.0877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8869  -16.9127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1705  -14.8501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8870  -14.4334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8869  -13.6084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3006  -12.8942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4756  -12.8954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0128  -12.4817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0128  -11.6524    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.7294  -12.8942    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  6  7  1  0
  7  8  1  0
  9  8  2  0
 10  9  1  0
 11 10  2  0
 12 11  1  0
 13 12  2  0
  8 13  1  0
 14  2  1  0
 15 14  1  0
 16 15  1  0
 16 17  1  0
 17 18  1  0
 18 14  1  0
 19 16  1  0
 20 19  1  0
 14 20  1  0
 16 21  1  0
 21 22  1  0
 23 22  1  1
 24 23  1  0
 24 25  1  0
 23 25  1  0
 24 26  1  6
 26 27  2  0
 26 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4642294

    ---

Associated Targets(Human)

FFAR4 Tchem G-protein coupled receptor 120 (2999 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Ffar4 Omega-3 fatty acid receptor 1 (147 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 378.47Molecular Weight (Monoisotopic): 378.1831AlogP: 5.52#Rotatable Bonds: 7
Polar Surface Area: 55.76Molecular Species: ACIDHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.25CX Basic pKa: CX LogP: 4.94CX LogD: 1.94
Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.69Np Likeness Score: 0.64

References

1. Dowarah J, Singh VP..  (2020)  Anti-diabetic drugs recent approaches and advancements.,  28  (5): [PMID:32008883] [10.1016/j.bmc.2019.115263]
2. Kerru N, Singh-Pillay A, Awolade P, Singh P..  (2018)  Current anti-diabetic agents and their molecular targets: A review.,  152  [PMID:29751237] [10.1016/j.ejmech.2018.04.061]

Source