N-((1R,3S)-3-(5-(1-(2,2-difluoroethyl)-4-methyl-1H-imidazol-5-yl)-4H-1,2,4-triazol-3-yl)cyclohexyl)-N-methyl-3-(trifluoromethyl)benzamide

ID: ALA4642312

PubChem CID: 134194625

Max Phase: Preclinical

Molecular Formula: C23H25F5N6O

Molecular Weight: 496.48

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ncn(CC(F)F)c1-c1nnc([C@H]2CCC[C@@H](N(C)C(=O)c3cccc(C(F)(F)F)c3)C2)[nH]1

Standard InChI:  InChI=1S/C23H25F5N6O/c1-13-19(34(12-29-13)11-18(24)25)21-30-20(31-32-21)14-5-4-8-17(10-14)33(2)22(35)15-6-3-7-16(9-15)23(26,27)28/h3,6-7,9,12,14,17-18H,4-5,8,10-11H2,1-2H3,(H,30,31,32)/t14-,17+/m0/s1

Standard InChI Key:  OGSWCIPCMCTXTK-WMLDXEAASA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   36.3430   -4.2386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3418   -5.0582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0499   -5.4671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7595   -5.0577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7567   -4.2350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0481   -3.8298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4629   -3.8238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1721   -4.2297    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.4598   -3.0066    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.1752   -5.0469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8783   -3.8184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5900   -4.2293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.2941   -3.8215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.2952   -3.0040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5861   -2.5959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8759   -3.0053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.0018   -4.2301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0497   -6.2843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3418   -6.6927    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   37.7573   -6.6931    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   37.0419   -7.0988    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   42.0865   -5.0394    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.8859   -5.2093    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   43.2945   -4.5016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.7476   -3.8944    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   44.1077   -4.4987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.5880   -5.1548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.3605   -4.9007    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   45.3576   -4.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.5833   -3.8391    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   44.3383   -5.9329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.5782   -3.0211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.2834   -2.6082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.2783   -1.7910    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   45.9936   -3.0123    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  7  9  2  0
  8 10  1  0
 11  8  1  6
 11 12  1  0
 11 16  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 13 17  1  6
  3 18  1  0
 18 19  1  0
 18 20  1  0
 18 21  1  0
 17 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 17  1  0
 24 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 26  1  0
 27 31  1  0
 30 32  1  0
 32 33  1  0
 33 34  1  0
 33 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4642312

    ---

Associated Targets(Human)

GPR142 Tchem Probable G-protein coupled receptor 142 (378 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 496.48Molecular Weight (Monoisotopic): 496.2010AlogP: 5.06#Rotatable Bonds: 6
Polar Surface Area: 79.70Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.94CX Basic pKa: 4.93CX LogP: 3.06CX LogD: 3.04
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.48Np Likeness Score: -1.26

References

1. Liu LZ, Ma T, Zhou J, Long Hu Z, Jun Zhang X, Zhen Zhang H, Zeng M, Liu J, Li L, Jiang Y, Zou Z, Wang F, Zhang L, Xu J, Wang J, Xiao F, Fang X, Zou H, Efanov AM, Thomas MK, Lin HV, Chen J..  (2020)  Discovery of LY3325656: A GPR142 agonist suitable for clinical testing in human.,  30  (5): [PMID:31982234] [10.1016/j.bmcl.2019.126857]
2.  (2019)  Cyclohexyl benzamide compounds,