N-[1-[1-[1-(4-fluorophenyl)indole-5-carbonyl]azetidin-3-yl]azetidin-3-yl]thiazole-4-carboxamide

ID: ALA4642478

PubChem CID: 66605581

Max Phase: Preclinical

Molecular Formula: C25H22FN5O2S

Molecular Weight: 475.55

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(NC1CN(C2CN(C(=O)c3ccc4c(ccn4-c4ccc(F)cc4)c3)C2)C1)c1cscn1

Standard InChI:  InChI=1S/C25H22FN5O2S/c26-18-2-4-20(5-3-18)31-8-7-16-9-17(1-6-23(16)31)25(33)30-12-21(13-30)29-10-19(11-29)28-24(32)22-14-34-15-27-22/h1-9,14-15,19,21H,10-13H2,(H,28,32)

Standard InChI Key:  VMXTXFBMQOUPJT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 39  0  0  0  0  0  0  0  0999 V2000
   29.9182   -5.0146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9182   -5.8359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7396   -5.8359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7396   -5.0146    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.3215   -4.4326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1429   -4.4326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1429   -3.6113    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.3216   -3.6113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7207   -3.0335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5142   -3.2450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5092   -2.2400    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.3363   -6.4178    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.5519   -7.2113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9699   -7.7933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3454   -7.4228    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.1579   -7.6659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7843   -8.3992    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   28.3663   -8.9812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0995   -8.6075    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.7241   -4.0390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5167   -4.2506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0881   -2.6647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8803   -2.8726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0962   -3.6650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9166   -3.7046    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.2077   -2.9365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5672   -2.4225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3645   -4.3881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9944   -5.1169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4416   -5.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2584   -5.7542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6259   -5.0196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1765   -4.3396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7072   -6.4371    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  1  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  5  1  0
  7  9  1  0
  9 10  1  0
  9 11  2  0
  2 12  1  0
 12 13  1  0
 13 14  1  0
 13 15  2  0
 14 16  2  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 10 20  2  0
 20 21  1  0
 21 24  2  0
 23 22  2  0
 22 10  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  2  0
 27 23  1  0
 25 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 31 34  1  0
M  END

Associated Targets(non-human)

Mgll Monoglyceride lipase (465 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 475.55Molecular Weight (Monoisotopic): 475.1478AlogP: 3.16#Rotatable Bonds: 5
Polar Surface Area: 70.47Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.66CX LogP: 3.11CX LogD: 3.11
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.48Np Likeness Score: -1.89

References

1. Zhu B, Connolly PJ, Zhang SP, Chevalier KM, Milligan CM, Flores CM, Macielag MJ..  (2020)  The discovery of diazetidinyl diamides as potent and reversible inhibitors of monoacylglycerol lipase (MAGL).,  30  (12): [PMID:32334914] [10.1016/j.bmcl.2020.127198]

Source