The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[1-[1-[1-(4-fluorophenyl)indole-5-carbonyl]azetidin-3-yl]azetidin-3-yl]thiazole-4-carboxamide ID: ALA4642478
PubChem CID: 66605581
Max Phase: Preclinical
Molecular Formula: C25H22FN5O2S
Molecular Weight: 475.55
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NC1CN(C2CN(C(=O)c3ccc4c(ccn4-c4ccc(F)cc4)c3)C2)C1)c1cscn1
Standard InChI: InChI=1S/C25H22FN5O2S/c26-18-2-4-20(5-3-18)31-8-7-16-9-17(1-6-23(16)31)25(33)30-12-21(13-30)29-10-19(11-29)28-24(32)22-14-34-15-27-22/h1-9,14-15,19,21H,10-13H2,(H,28,32)
Standard InChI Key: VMXTXFBMQOUPJT-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 39 0 0 0 0 0 0 0 0999 V2000
29.9182 -5.0146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9182 -5.8359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7396 -5.8359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7396 -5.0146 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.3215 -4.4326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1429 -4.4326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1429 -3.6113 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.3216 -3.6113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7207 -3.0335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5142 -3.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5092 -2.2400 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.3363 -6.4178 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.5519 -7.2113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9699 -7.7933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3454 -7.4228 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.1579 -7.6659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7843 -8.3992 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
28.3663 -8.9812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0995 -8.6075 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.7241 -4.0390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5167 -4.2506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0881 -2.6647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8803 -2.8726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0962 -3.6650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9166 -3.7046 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.2077 -2.9365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5672 -2.4225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3645 -4.3881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9944 -5.1169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4416 -5.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2584 -5.7542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6259 -5.0196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1765 -4.3396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7072 -6.4371 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 1 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 5 1 0
7 9 1 0
9 10 1 0
9 11 2 0
2 12 1 0
12 13 1 0
13 14 1 0
13 15 2 0
14 16 2 0
16 17 1 0
17 18 1 0
18 19 2 0
19 14 1 0
10 20 2 0
20 21 1 0
21 24 2 0
23 22 2 0
22 10 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 23 1 0
25 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
31 34 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 475.55Molecular Weight (Monoisotopic): 475.1478AlogP: 3.16#Rotatable Bonds: 5Polar Surface Area: 70.47Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 4.66CX LogP: 3.11CX LogD: 3.11Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.48Np Likeness Score: -1.89
References 1. Zhu B, Connolly PJ, Zhang SP, Chevalier KM, Milligan CM, Flores CM, Macielag MJ.. (2020) The discovery of diazetidinyl diamides as potent and reversible inhibitors of monoacylglycerol lipase (MAGL)., 30 (12): [PMID:32334914 ] [10.1016/j.bmcl.2020.127198 ]