The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Methoxy-4-((E)-3,4,5-trimethoxystyryl)phenyl oleate ID: ALA4642707
PubChem CID: 156016967
Max Phase: Preclinical
Molecular Formula: C36H52O6
Molecular Weight: 580.81
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCC/C=C\CCCCCCCC(=O)Oc1ccc(/C=C/c2cc(OC)c(OC)c(OC)c2)cc1OC
Standard InChI: InChI=1S/C36H52O6/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-35(37)42-31-25-24-29(26-32(31)38-2)22-23-30-27-33(39-3)36(41-5)34(28-30)40-4/h13-14,22-28H,6-12,15-21H2,1-5H3/b14-13-,23-22+
Standard InChI Key: BUOXVZCCVKACEX-CQMMSTNWSA-N
Molfile:
RDKit 2D
42 43 0 0 0 0 0 0 0 0999 V2000
21.2220 -17.5441 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.2280 -18.3654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9428 -18.7730 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.5192 -18.7833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5251 -19.6046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8204 -20.0183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1056 -19.6149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3968 -20.0287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6820 -19.6252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9732 -20.0390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2584 -19.6356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5495 -20.0493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5555 -20.8706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2703 -21.2782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9791 -20.8603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6939 -21.2678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4027 -20.8500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1175 -21.2575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8264 -20.8396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5371 -21.2472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6536 -16.3617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3603 -15.9402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0772 -16.3441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0851 -17.1631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8011 -17.5628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5046 -17.1453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4918 -16.3199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7752 -15.9198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9368 -15.9579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9316 -15.1374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2156 -14.7378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5079 -15.1552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5208 -15.9807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2373 -16.3808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7905 -14.7564 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2058 -13.9165 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.8155 -16.4046 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0885 -15.1747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8286 -17.2258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9127 -13.4953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1970 -15.8959 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.1839 -15.0747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
26 1 1 0
21 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
32 35 1 0
31 36 1 0
33 37 1 0
35 38 1 0
37 39 1 0
36 40 1 0
27 41 1 0
41 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 580.81Molecular Weight (Monoisotopic): 580.3764AlogP: 9.83#Rotatable Bonds: 22Polar Surface Area: 63.22Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 10.30CX LogD: 10.30Aromatic Rings: 2Heavy Atoms: 42QED Weighted: 0.05Np Likeness Score: 0.44
References 1. Wong T, Narayanan S, Brown DP, Chen ZS.. (2020) Synthesis and Cytotoxicity Studies of Stilbene Long-Chain Fatty Acid Conjugates., 83 (5): [PMID:32243160 ] [10.1021/acs.jnatprod.0c00027 ]