2-Methoxy-4-((E)-3,4,5-trimethoxystyryl)phenyl oleate

ID: ALA4642707

PubChem CID: 156016967

Max Phase: Preclinical

Molecular Formula: C36H52O6

Molecular Weight: 580.81

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCCCCC/C=C\CCCCCCCC(=O)Oc1ccc(/C=C/c2cc(OC)c(OC)c(OC)c2)cc1OC

Standard InChI:  InChI=1S/C36H52O6/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-35(37)42-31-25-24-29(26-32(31)38-2)22-23-30-27-33(39-3)36(41-5)34(28-30)40-4/h13-14,22-28H,6-12,15-21H2,1-5H3/b14-13-,23-22+

Standard InChI Key:  BUOXVZCCVKACEX-CQMMSTNWSA-N

Molfile:  

 
     RDKit          2D

 42 43  0  0  0  0  0  0  0  0999 V2000
   21.2220  -17.5441    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.2280  -18.3654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9428  -18.7730    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.5192  -18.7833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5251  -19.6046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8204  -20.0183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1056  -19.6149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3968  -20.0287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6820  -19.6252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9732  -20.0390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2584  -19.6356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5495  -20.0493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5555  -20.8706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2703  -21.2782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9791  -20.8603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6939  -21.2678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4027  -20.8500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1175  -21.2575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8264  -20.8396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5371  -21.2472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6536  -16.3617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3603  -15.9402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0772  -16.3441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0851  -17.1631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8011  -17.5628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5046  -17.1453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4918  -16.3199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7752  -15.9198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9368  -15.9579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9316  -15.1374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2156  -14.7378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5079  -15.1552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5208  -15.9807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2373  -16.3808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7905  -14.7564    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.2058  -13.9165    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.8155  -16.4046    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.0885  -15.1747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8286  -17.2258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9127  -13.4953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1970  -15.8959    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.1839  -15.0747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 26  1  1  0
 21 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 32 35  1  0
 31 36  1  0
 33 37  1  0
 35 38  1  0
 37 39  1  0
 36 40  1  0
 27 41  1  0
 41 42  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4642707

    ---

Associated Targets(Human)

KB 3-1 (1143 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NCI-H460 (60772 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HEK293 (82097 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MCF7 (126967 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 580.81Molecular Weight (Monoisotopic): 580.3764AlogP: 9.83#Rotatable Bonds: 22
Polar Surface Area: 63.22Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 10.30CX LogD: 10.30
Aromatic Rings: 2Heavy Atoms: 42QED Weighted: 0.05Np Likeness Score: 0.44

References

1. Wong T, Narayanan S, Brown DP, Chen ZS..  (2020)  Synthesis and Cytotoxicity Studies of Stilbene Long-Chain Fatty Acid Conjugates.,  83  (5): [PMID:32243160] [10.1021/acs.jnatprod.0c00027]

Source