N-methyl-N-(1-(2-((4-carboxylphenyl)amino)benzoyl)piperidin-4-yl)-2-trifluoromethyl-4-fluoro-benzamide

ID: ALA4642779

PubChem CID: 156017414

Max Phase: Preclinical

Molecular Formula: C28H25F4N3O4

Molecular Weight: 543.52

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN(C(=O)c1ccc(F)cc1C(F)(F)F)C1CCN(C(=O)c2ccccc2Nc2ccc(C(=O)O)cc2)CC1

Standard InChI:  InChI=1S/C28H25F4N3O4/c1-34(25(36)21-11-8-18(29)16-23(21)28(30,31)32)20-12-14-35(15-13-20)26(37)22-4-2-3-5-24(22)33-19-9-6-17(7-10-19)27(38)39/h2-11,16,20,33H,12-15H2,1H3,(H,38,39)

Standard InChI Key:  YHHSTWFFSXUGJI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 39 42  0  0  0  0  0  0  0  0999 V2000
    7.1285  -20.1943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9539  -20.1954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3679  -19.4817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9534  -18.7665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1250  -18.7693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7188  -19.4835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7172  -20.9112    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.3690  -20.9127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9528  -21.6251    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.1962  -20.9134    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6035  -21.6278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4270  -21.6304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8471  -20.9199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4333  -20.2008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6035  -20.1965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6742  -20.9236    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.0825  -21.6383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0891  -20.2086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6678  -22.3532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9097  -21.6420    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.8427  -22.3466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4239  -23.0607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8363  -23.7805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6677  -23.7816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0787  -23.0669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8942  -20.9136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4835  -20.2009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6613  -20.2028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2509  -20.9173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6688  -21.6312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4896  -21.6258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4232  -24.4924    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.9017  -23.0666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3134  -23.7792    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   13.3129  -22.3537    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   13.7210  -23.0651    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.4279  -20.9206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0135  -20.2096    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0192  -21.6351    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  1  7  1  0
  2  8  1  0
  8  9  2  0
  8 10  1  0
 10 11  1  0
 10 15  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 13 16  1  0
 16 17  1  0
 16 18  1  0
 17 19  1  0
 17 20  2  0
 19 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 19  1  0
  7 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 23 32  1  0
 25 33  1  0
 33 34  1  0
 33 35  1  0
 33 36  1  0
 29 37  1  0
 37 38  1  0
 37 39  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4642779

    ---

Associated Targets(Human)

SMO Tclin Smoothened homolog (1371 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 543.52Molecular Weight (Monoisotopic): 543.1781AlogP: 5.66#Rotatable Bonds: 6
Polar Surface Area: 89.95Molecular Species: ACIDHBA: 4HBD: 2
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 4.65CX Basic pKa: CX LogP: 5.80CX LogD: 3.11
Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.39Np Likeness Score: -1.49

References

1. Ji D, Zhang W, Xu Y, Zhang JJ..  (2020)  Design, synthesis and biological evaluation of anthranilamide derivatives as potent SMO inhibitors.,  28  (6): [PMID:32063403] [10.1016/j.bmc.2020.115354]

Source