The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-[1-[1-[4-[5-(trifluoromethyl)-2-thienyl]benzoyl]azetidin-3-yl]azetidin-3-yl]isoindolin-1-one ID: ALA4642828
PubChem CID: 56925271
Max Phase: Preclinical
Molecular Formula: C26H22F3N3O2S
Molecular Weight: 497.54
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(c1ccc(-c2ccc(C(F)(F)F)s2)cc1)N1CC(N2CC(N3Cc4ccccc4C3=O)C2)C1
Standard InChI: InChI=1S/C26H22F3N3O2S/c27-26(28,29)23-10-9-22(35-23)16-5-7-17(8-6-16)24(33)31-12-19(13-31)30-14-20(15-30)32-11-18-3-1-2-4-21(18)25(32)34/h1-10,19-20H,11-15H2
Standard InChI Key: MULBVLQEOVAYOP-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 40 0 0 0 0 0 0 0 0999 V2000
31.6605 -12.8321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0823 -13.4154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6657 -13.9936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2439 -13.4103 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.0669 -13.4067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6502 -13.9849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2284 -13.4016 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.6451 -12.8234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0456 -13.3980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4602 -14.1068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4539 -12.6855 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.2593 -13.4190 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.0503 -14.8185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4642 -15.5268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2763 -14.0987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7731 -12.7586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7790 -14.0903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9951 -13.8395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9917 -13.0174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2792 -12.6111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5696 -13.0257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5770 -13.8509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2900 -14.2535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0210 -11.9800 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.6926 -14.8040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2923 -15.5211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7090 -16.2235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3847 -16.9736 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
36.9978 -17.5139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7011 -17.0977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5226 -16.3003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9210 -18.3275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1781 -18.6678 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
37.5872 -18.8007 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
36.9139 -19.1421 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 1 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 5 1 0
7 9 1 0
9 10 1 0
9 11 2 0
2 12 1 0
10 13 2 0
13 14 1 0
14 26 2 0
25 15 2 0
15 10 1 0
12 16 1 0
16 19 1 0
18 17 1 0
17 12 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
16 24 2 0
25 26 1 0
27 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 27 2 0
26 27 1 0
29 32 1 0
32 33 1 0
32 34 1 0
32 35 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 497.54Molecular Weight (Monoisotopic): 497.1385AlogP: 4.60#Rotatable Bonds: 4Polar Surface Area: 43.86Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 5.12CX LogP: 4.35CX LogD: 4.35Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.53Np Likeness Score: -0.81
References 1. Zhu B, Connolly PJ, Zhang SP, Chevalier KM, Milligan CM, Flores CM, Macielag MJ.. (2020) The discovery of diazetidinyl diamides as potent and reversible inhibitors of monoacylglycerol lipase (MAGL)., 30 (12): [PMID:32334914 ] [10.1016/j.bmcl.2020.127198 ]