2-[1-[1-[4-[5-(trifluoromethyl)-2-thienyl]benzoyl]azetidin-3-yl]azetidin-3-yl]isoindolin-1-one

ID: ALA4642828

PubChem CID: 56925271

Max Phase: Preclinical

Molecular Formula: C26H22F3N3O2S

Molecular Weight: 497.54

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(c1ccc(-c2ccc(C(F)(F)F)s2)cc1)N1CC(N2CC(N3Cc4ccccc4C3=O)C2)C1

Standard InChI:  InChI=1S/C26H22F3N3O2S/c27-26(28,29)23-10-9-22(35-23)16-5-7-17(8-6-16)24(33)31-12-19(13-31)30-14-20(15-30)32-11-18-3-1-2-4-21(18)25(32)34/h1-10,19-20H,11-15H2

Standard InChI Key:  MULBVLQEOVAYOP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 40  0  0  0  0  0  0  0  0999 V2000
   31.6605  -12.8321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0823  -13.4154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6657  -13.9936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2439  -13.4103    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.0669  -13.4067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6502  -13.9849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2284  -13.4016    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.6451  -12.8234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0456  -13.3980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4602  -14.1068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4539  -12.6855    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.2593  -13.4190    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.0503  -14.8185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4642  -15.5268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2763  -14.0987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7731  -12.7586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7790  -14.0903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9951  -13.8395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9917  -13.0174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2792  -12.6111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5696  -13.0257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5770  -13.8509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2900  -14.2535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0210  -11.9800    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.6926  -14.8040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2923  -15.5211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7090  -16.2235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3847  -16.9736    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   36.9978  -17.5139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7011  -17.0977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5226  -16.3003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9210  -18.3275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1781  -18.6678    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   37.5872  -18.8007    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   36.9139  -19.1421    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  1  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  5  1  0
  7  9  1  0
  9 10  1  0
  9 11  2  0
  2 12  1  0
 10 13  2  0
 13 14  1  0
 14 26  2  0
 25 15  2  0
 15 10  1  0
 12 16  1  0
 16 19  1  0
 18 17  1  0
 17 12  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 16 24  2  0
 25 26  1  0
 27 28  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 27  2  0
 26 27  1  0
 29 32  1  0
 32 33  1  0
 32 34  1  0
 32 35  1  0
M  END

Associated Targets(non-human)

Mgll Monoglyceride lipase (465 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 497.54Molecular Weight (Monoisotopic): 497.1385AlogP: 4.60#Rotatable Bonds: 4
Polar Surface Area: 43.86Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 5.12CX LogP: 4.35CX LogD: 4.35
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.53Np Likeness Score: -0.81

References

1. Zhu B, Connolly PJ, Zhang SP, Chevalier KM, Milligan CM, Flores CM, Macielag MJ..  (2020)  The discovery of diazetidinyl diamides as potent and reversible inhibitors of monoacylglycerol lipase (MAGL).,  30  (12): [PMID:32334914] [10.1016/j.bmcl.2020.127198]

Source