O-((41S,13aS)-13a-ethyl-2,3,41,5,6,13a-hexahydro-1H-indolo[3,2,1-de]pyrido[3,2,1-ij][1,5]naphthyridin-12-yl)methyl benzylcarbamothioate

ID: ALA4643016

PubChem CID: 156016824

Max Phase: Preclinical

Molecular Formula: C28H31N3OS

Molecular Weight: 457.64

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC[C@@]12C=C(COC(=S)NCc3ccccc3)n3c4c(c5ccccc53)CCN(CCC1)[C@H]42

Standard InChI:  InChI=1S/C28H31N3OS/c1-2-28-14-8-15-30-16-13-23-22-11-6-7-12-24(22)31(25(23)26(28)30)21(17-28)19-32-27(33)29-18-20-9-4-3-5-10-20/h3-7,9-12,17,26H,2,8,13-16,18-19H2,1H3,(H,29,33)/t26-,28+/m1/s1

Standard InChI Key:  UOMQRXKNLJCZSQ-IAPPQJPRSA-N

Molfile:  

 
     RDKit          2D

 34 39  0  0  0  0  0  0  0  0999 V2000
    9.4805  -28.9352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9081  -28.9352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1943  -28.5174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4805  -29.7623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7731  -30.9957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4869  -31.4051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1903  -30.1717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2007  -30.9922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9125  -31.3913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6186  -30.9744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6082  -30.1538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8918  -29.7502    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.7737  -30.1760    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0573  -31.4101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3405  -30.9973    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.2124  -29.3611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6899  -28.6901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3475  -27.9433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5279  -27.8661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0519  -28.5418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3968  -29.2861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1842  -29.3411    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.1925  -31.8182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9047  -32.2387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6247  -31.4117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9080  -30.9990    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6257  -32.2388    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.1921  -31.4133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4754  -31.0006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4787  -30.1735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7629  -29.7608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0461  -30.1752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0496  -31.0066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7661  -31.4156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  4  2  0
  1  3  1  0
 12  2  1  0
  2  3  1  0
  7  4  1  0
 13  5  1  0
  5  6  2  0
  6  8  1  0
  7  8  1  0
  7 12  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 13  4  1  0
  1 17  1  0
 16 13  1  0
  5 14  1  0
 14 15  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
  7 22  1  6
  8 23  1  6
 23 24  1  0
 15 25  1  0
 25 26  1  0
 25 27  2  0
 26 28  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4643016

    ---

Associated Targets(Human)

PDE1A Tclin Phosphodiesterase 1A (251 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 457.64Molecular Weight (Monoisotopic): 457.2188AlogP: 5.68#Rotatable Bonds: 5
Polar Surface Area: 29.43Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.60CX Basic pKa: 7.06CX LogP: 5.67CX LogD: 5.61
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.50Np Likeness Score: 0.29

References

1. Pan BW, Shi Y, Li WC, Wang Q, Pan M, Wu Q, Fu HZ..  (2020)  Synthesis and biological evaluation of Vinpocetine derivatives.,  30  (2): [PMID:31859156] [10.1016/j.bmcl.2019.05.052]

Source