rac-1-([1,1'-biphenyl]-4-yloxy)-3-(4-phenylpiperazin-1-yl)propan-2-ol

ID: ALA4643089

PubChem CID: 2937889

Max Phase: Preclinical

Molecular Formula: C25H28N2O2

Molecular Weight: 388.51

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  OC(COc1ccc(-c2ccccc2)cc1)CN1CCN(c2ccccc2)CC1

Standard InChI:  InChI=1S/C25H28N2O2/c28-24(19-26-15-17-27(18-16-26)23-9-5-2-6-10-23)20-29-25-13-11-22(12-14-25)21-7-3-1-4-8-21/h1-14,24,28H,15-20H2

Standard InChI Key:  ZABDAXAUNMVYBF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
    1.7236  -11.9085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7224  -12.7358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4373  -13.1488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1537  -12.7353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1509  -11.9049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4355  -11.4957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4389  -13.9716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7227  -14.3833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7222  -15.2075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4371  -15.6210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1541  -15.2042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1511  -14.3813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4330  -10.6707    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1462  -10.2560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8619  -10.6664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8644  -11.4914    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5752  -10.2518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2909  -10.6622    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2934  -11.4872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0041  -10.2475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7199  -10.6579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7223  -11.4829    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4380  -11.8932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0091  -11.8976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4373  -12.7180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1522  -13.1283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8664  -12.7135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8613  -11.8843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1458  -11.4777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  3  7  1  0
  6 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  1  0
 20 21  1  0
 19 24  1  0
 21 22  1  0
 22 23  1  0
 22 24  1  0
 23 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 23  1  0
M  END

Associated Targets(Human)

SK-MEL-5 (47095 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SK-MEL-28 (48833 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
A-375 (9258 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 388.51Molecular Weight (Monoisotopic): 388.2151AlogP: 3.92#Rotatable Bonds: 7
Polar Surface Area: 35.94Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.55CX LogP: 4.59CX LogD: 4.20
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.67Np Likeness Score: -1.06

References

1. Chang Q, Long J, Hu L, Chen Z, Li Q, Hu G..  (2020)  Drug repurposing and rediscovery: Design, synthesis and preliminary biological evaluation of 1-arylamino-3-aryloxypropan-2-ols as anti-melanoma agents.,  28  (9): [PMID:32216987] [10.1016/j.bmc.2020.115404]

Source