The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[1-[1-[4-[3-(trifluoromethyl)phenyl]benzoyl]azetidin-3-yl]azetidin-3-yl]thiazole-2-carboxamide ID: ALA4643128
PubChem CID: 56924921
Max Phase: Preclinical
Molecular Formula: C24H21F3N4O2S
Molecular Weight: 486.52
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NC1CN(C2CN(C(=O)c3ccc(-c4cccc(C(F)(F)F)c4)cc3)C2)C1)c1nccs1
Standard InChI: InChI=1S/C24H21F3N4O2S/c25-24(26,27)18-3-1-2-17(10-18)15-4-6-16(7-5-15)23(33)31-13-20(14-31)30-11-19(12-30)29-21(32)22-28-8-9-34-22/h1-10,19-20H,11-14H2,(H,29,32)
Standard InChI Key: GKGCWPWOUSRMCA-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
3.7846 -21.8330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7846 -22.6543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6060 -22.6543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6060 -21.8330 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1879 -21.2510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0093 -21.2511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0093 -20.4298 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1880 -20.4298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5871 -19.8519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3806 -20.0634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3756 -19.0584 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2027 -23.2363 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4183 -24.0298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8363 -24.6117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2118 -24.2413 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0243 -24.4843 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.6507 -25.2177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2327 -25.7997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9659 -25.4259 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5904 -20.8575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3831 -21.0691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9639 -20.4874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7467 -19.6910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9545 -19.4831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7506 -20.6947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9631 -21.4849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7522 -21.6944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3295 -21.1148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1122 -20.3226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3236 -20.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9654 -22.4833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3888 -23.0624 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.7552 -22.6931 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.1724 -23.2693 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 1 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 5 1 0
7 9 1 0
9 10 1 0
9 11 2 0
2 12 1 0
12 13 1 0
13 14 1 0
13 15 2 0
14 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 14 2 0
10 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 10 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
22 25 1 0
27 31 1 0
31 32 1 0
31 33 1 0
31 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 486.52Molecular Weight (Monoisotopic): 486.1337AlogP: 3.77#Rotatable Bonds: 5Polar Surface Area: 65.54Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.25CX Basic pKa: 4.37CX LogP: 3.50CX LogD: 3.50Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.60Np Likeness Score: -1.50
References 1. Zhu B, Connolly PJ, Zhang SP, Chevalier KM, Milligan CM, Flores CM, Macielag MJ.. (2020) The discovery of diazetidinyl diamides as potent and reversible inhibitors of monoacylglycerol lipase (MAGL)., 30 (12): [PMID:32334914 ] [10.1016/j.bmcl.2020.127198 ]