O-((41S,13aS)-13a-ethyl-2,3,41,5,6,13a-hexahydro-1H-indolo[3,2,1-de]pyrido[3,2,1-ij][1,5]naphthyridin-12-yl)methyl naphthalen-1-ylcarbamothioate

ID: ALA4643153

PubChem CID: 156018524

Max Phase: Preclinical

Molecular Formula: C31H31N3OS

Molecular Weight: 493.68

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC[C@@]12C=C(COC(=S)Nc3cccc4ccccc34)n3c4c(c5ccccc53)CCN(CCC1)[C@H]42

Standard InChI:  InChI=1S/C31H31N3OS/c1-2-31-16-8-17-33-18-15-25-24-12-5-6-14-27(24)34(28(25)29(31)33)22(19-31)20-35-30(36)32-26-13-7-10-21-9-3-4-11-23(21)26/h3-7,9-14,19,29H,2,8,15-18,20H2,1H3,(H,32,36)/t29-,31+/m1/s1

Standard InChI Key:  KMXSEKYVDFGBAT-VEEOACQBSA-N

Molfile:  

 
     RDKit          2D

 37 43  0  0  0  0  0  0  0  0999 V2000
   37.7748  -22.7639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2031  -22.7639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4889  -22.3460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7748  -23.5914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0670  -24.8255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7812  -25.2351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4850  -24.0010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4953  -24.8220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2075  -25.2212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9139  -24.8041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9036  -23.9832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1868  -23.5794    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.0676  -24.0054    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.3509  -25.2401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6338  -24.8271    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.5060  -23.1900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9838  -22.5188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6412  -21.7715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8212  -21.6944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3450  -22.3704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6901  -23.1150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4788  -23.1701    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   38.4871  -25.6483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1997  -26.0691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9176  -25.2417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2005  -24.8287    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.9185  -26.0692    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   33.4844  -25.2433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0526  -26.0699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7748  -26.4827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4875  -26.0665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0521  -25.2416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7678  -24.8283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7668  -24.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0509  -23.5915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3345  -24.0097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3390  -24.8329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  4  2  0
  1  3  1  0
 12  2  1  0
  2  3  1  0
  7  4  1  0
 13  5  1  0
  5  6  2  0
  6  8  1  0
  7  8  1  0
  7 12  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 13  4  1  0
  1 17  1  0
 16 13  1  0
  5 14  1  0
 14 15  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
  7 22  1  6
  8 23  1  6
 23 24  1  0
 15 25  1  0
 25 26  1  0
 25 27  2  0
 26 28  1  0
 28 33  2  0
 32 29  2  0
 29 30  1  0
 30 31  2  0
 31 28  1  0
 32 33  1  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4643153

    ---

Associated Targets(Human)

PDE1A Tclin Phosphodiesterase 1A (251 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 493.68Molecular Weight (Monoisotopic): 493.2188AlogP: 7.15#Rotatable Bonds: 4
Polar Surface Area: 29.43Molecular Species: ACIDHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 6.49CX Basic pKa: 7.21CX LogP: 6.29CX LogD: 6.21
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.31Np Likeness Score: 0.18

References

1. Pan BW, Shi Y, Li WC, Wang Q, Pan M, Wu Q, Fu HZ..  (2020)  Synthesis and biological evaluation of Vinpocetine derivatives.,  30  (2): [PMID:31859156] [10.1016/j.bmcl.2019.05.052]

Source