O-((41S,13aS)-13a-ethyl-2,3,41,5,6,13a-hexahydro-1H-indolo[3,2,1-de]pyrido[3,2,1-ij][1,5]naphthyridin-12-yl)methyl m-tolylcarbamothioate

ID: ALA4643199

PubChem CID: 156018878

Max Phase: Preclinical

Molecular Formula: C28H31N3OS

Molecular Weight: 457.64

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC[C@@]12C=C(COC(=S)Nc3cccc(C)c3)n3c4c(c5ccccc53)CCN(CCC1)[C@H]42

Standard InChI:  InChI=1S/C28H31N3OS/c1-3-28-13-7-14-30-15-12-23-22-10-4-5-11-24(22)31(25(23)26(28)30)21(17-28)18-32-27(33)29-20-9-6-8-19(2)16-20/h4-6,8-11,16-17,26H,3,7,12-15,18H2,1-2H3,(H,29,33)/t26-,28+/m1/s1

Standard InChI Key:  SCPYGQFMZOBJLW-IAPPQJPRSA-N

Molfile:  

 
     RDKit          2D

 34 39  0  0  0  0  0  0  0  0999 V2000
    9.5403   -2.8429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9509   -2.8429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2456   -2.4302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5403   -3.6601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8414   -4.8789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5467   -5.2833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2416   -4.0646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2518   -4.8754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9551   -5.2697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6527   -4.8577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6425   -4.0470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9347   -3.6483    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.8419   -4.0689    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1341   -5.2882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4260   -4.8804    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.2874   -3.2637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7591   -2.6008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4209   -1.8629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6111   -1.7867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1407   -2.4544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4816   -3.1896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2355   -3.2440    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.2438   -5.6914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9474   -6.1070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7187   -5.2898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0105   -4.8820    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.7196   -6.1070    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.3033   -5.2914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5957   -4.8810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8890   -5.2897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8894   -6.1078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6026   -6.5154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3064   -6.1044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1810   -4.8816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  4  2  0
  1  3  1  0
 12  2  1  0
  2  3  1  0
  7  4  1  0
 13  5  1  0
  5  6  2  0
  6  8  1  0
  7  8  1  0
  7 12  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 13  4  1  0
  1 17  1  0
 16 13  1  0
  5 14  1  0
 14 15  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
  7 22  1  6
  8 23  1  6
 23 24  1  0
 15 25  1  0
 25 26  1  0
 25 27  2  0
 26 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 30 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4643199

    ---

Associated Targets(Human)

PDE1A Tclin Phosphodiesterase 1A (251 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 457.64Molecular Weight (Monoisotopic): 457.2188AlogP: 6.31#Rotatable Bonds: 4
Polar Surface Area: 29.43Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 6.52CX Basic pKa: 7.22CX LogP: 5.83CX LogD: 5.75
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.47Np Likeness Score: 0.05

References

1. Pan BW, Shi Y, Li WC, Wang Q, Pan M, Wu Q, Fu HZ..  (2020)  Synthesis and biological evaluation of Vinpocetine derivatives.,  30  (2): [PMID:31859156] [10.1016/j.bmcl.2019.05.052]

Source