N-(((41S,13aS)-13a-ethyl-2,3,41,5,6,13a-hexahydro-1H-indolo[3,2,1-de]pyrido[3,2,1-ij][1,5]naphthyridin-12-yl)methylcarbamothioyl)benzamide

ID: ALA4643607

PubChem CID: 156018549

Max Phase: Preclinical

Molecular Formula: C28H30N4OS

Molecular Weight: 470.64

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC[C@@]12C=C(CNC(=S)NC(=O)c3ccccc3)n3c4c(c5ccccc53)CCN(CCC1)[C@H]42

Standard InChI:  InChI=1S/C28H30N4OS/c1-2-28-14-8-15-31-16-13-22-21-11-6-7-12-23(21)32(24(22)25(28)31)20(17-28)18-29-27(34)30-26(33)19-9-4-3-5-10-19/h3-7,9-12,17,25H,2,8,13-16,18H2,1H3,(H2,29,30,33,34)/t25-,28+/m1/s1

Standard InChI Key:  SJBZNXLQOHWAEQ-NAKRPHOHSA-N

Molfile:  

 
     RDKit          2D

 35 40  0  0  0  0  0  0  0  0999 V2000
   10.1222   -4.1017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5328   -4.1017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8275   -3.6890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1222   -4.9189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4233   -6.1377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1286   -6.5421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8236   -5.3235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8338   -6.1342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5371   -6.5285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2347   -6.1165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2245   -5.3058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5166   -4.9071    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.4238   -5.3278    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.7161   -6.5470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8693   -4.5225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3411   -3.8596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0028   -3.1218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1930   -3.0455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7226   -3.7132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0635   -4.4484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8175   -4.5028    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.8257   -6.9503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5294   -7.3658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0079   -6.1392    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.3006   -6.5486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5925   -6.1408    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.3016   -7.3658    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.8852   -6.5502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1771   -6.1424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8861   -7.3674    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1804   -5.3252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4731   -4.9175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7649   -5.3270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7684   -6.1484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4763   -6.5524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  4  2  0
  1  3  1  0
 12  2  1  0
  2  3  1  0
  7  4  1  0
 13  5  1  0
  5  6  2  0
  6  8  1  0
  7  8  1  0
  7 12  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 13  4  1  0
  1 16  1  0
 15 13  1  0
  5 14  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
  7 21  1  6
  8 22  1  6
 22 23  1  0
 14 24  1  0
 24 25  1  0
 25 26  1  0
 25 27  2  0
 26 28  1  0
 28 29  1  0
 28 30  2  0
 29 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4643607

    ---

Associated Targets(Human)

PDE1A Tclin Phosphodiesterase 1A (251 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 470.64Molecular Weight (Monoisotopic): 470.2140AlogP: 4.89#Rotatable Bonds: 4
Polar Surface Area: 49.30Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 11.48CX Basic pKa: 7.17CX LogP: 4.97CX LogD: 4.77
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.53Np Likeness Score: -0.12

References

1. Pan BW, Shi Y, Li WC, Wang Q, Pan M, Wu Q, Fu HZ..  (2020)  Synthesis and biological evaluation of Vinpocetine derivatives.,  30  (2): [PMID:31859156] [10.1016/j.bmcl.2019.05.052]

Source