The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-[6-amino-4-(trifluoromethyl)-3-pyridyl]-N-butyl-4-morpholino-pyrrolo[2,1-f][1,2,4]triazine-6-carboxamide ID: ALA4643948
PubChem CID: 156018200
Max Phase: Preclinical
Molecular Formula: C21H24F3N7O2
Molecular Weight: 463.46
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCNC(=O)c1cc2c(N3CCOCC3)nc(-c3cnc(N)cc3C(F)(F)F)nn2c1
Standard InChI: InChI=1S/C21H24F3N7O2/c1-2-3-4-26-20(32)13-9-16-19(30-5-7-33-8-6-30)28-18(29-31(16)12-13)14-11-27-17(25)10-15(14)21(22,23)24/h9-12H,2-8H2,1H3,(H2,25,27)(H,26,32)
Standard InChI Key: KQGHRDLSIMEZJO-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
15.9676 -15.4413 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.6797 -15.0299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3880 -15.4407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3880 -16.2643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6823 -16.6708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9676 -16.2654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2605 -16.6743 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.0952 -16.6732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8064 -16.2643 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
18.0952 -17.4909 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
18.8064 -17.0820 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
18.1002 -15.0289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1006 -14.2094 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.8103 -13.8003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5228 -14.2081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5250 -15.0259 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.8168 -15.4432 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.3029 -15.2804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7833 -14.6178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2993 -13.9577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6010 -14.6178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0099 -13.9065 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.8276 -13.9065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2324 -13.1994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0501 -13.1994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4590 -12.4923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0099 -15.3249 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.8103 -12.9825 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.1031 -12.5737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1031 -11.7560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8103 -11.3471 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.5174 -11.7559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5174 -12.5737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
6 7 1 0
4 8 1 0
8 9 1 0
8 10 1 0
8 11 1 0
12 3 1 0
13 12 1 0
14 13 2 0
15 14 1 0
16 15 1 0
17 16 1 0
12 17 2 0
16 18 1 0
19 18 2 0
20 19 1 0
15 20 2 0
19 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
21 27 2 0
14 28 1 0
29 28 1 0
30 29 1 0
31 30 1 0
32 31 1 0
33 32 1 0
28 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 463.46Molecular Weight (Monoisotopic): 463.1944AlogP: 2.76#Rotatable Bonds: 6Polar Surface Area: 110.67Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 5.11CX LogP: 3.59CX LogD: 3.58Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.54Np Likeness Score: -1.31
References 1. Xiang HY, Chen YH, Wang Y, Zhang X, Ding J, Meng LH, Yang CH.. (2020) Design, synthesis and antiproliferative activity evaluation of a series of pyrrolo[2,1-f][1,2,4]triazine derivatives., 30 (12): [PMID:32317209 ] [10.1016/j.bmcl.2020.127194 ]