2-[6-amino-4-(trifluoromethyl)-3-pyridyl]-N-butyl-4-morpholino-pyrrolo[2,1-f][1,2,4]triazine-6-carboxamide

ID: ALA4643948

PubChem CID: 156018200

Max Phase: Preclinical

Molecular Formula: C21H24F3N7O2

Molecular Weight: 463.46

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCNC(=O)c1cc2c(N3CCOCC3)nc(-c3cnc(N)cc3C(F)(F)F)nn2c1

Standard InChI:  InChI=1S/C21H24F3N7O2/c1-2-3-4-26-20(32)13-9-16-19(30-5-7-33-8-6-30)28-18(29-31(16)12-13)14-11-27-17(25)10-15(14)21(22,23)24/h9-12H,2-8H2,1H3,(H2,25,27)(H,26,32)

Standard InChI Key:  KQGHRDLSIMEZJO-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   15.9676  -15.4413    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.6797  -15.0299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3880  -15.4407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3880  -16.2643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6823  -16.6708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9676  -16.2654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2605  -16.6743    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.0952  -16.6732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8064  -16.2643    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   18.0952  -17.4909    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   18.8064  -17.0820    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   18.1002  -15.0289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1006  -14.2094    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.8103  -13.8003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5228  -14.2081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5250  -15.0259    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.8168  -15.4432    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.3029  -15.2804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7833  -14.6178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2993  -13.9577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6010  -14.6178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0099  -13.9065    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.8276  -13.9065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2324  -13.1994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0501  -13.1994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4590  -12.4923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0099  -15.3249    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.8103  -12.9825    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.1031  -12.5737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1031  -11.7560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8103  -11.3471    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.5174  -11.7559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5174  -12.5737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  6  7  1  0
  4  8  1  0
  8  9  1  0
  8 10  1  0
  8 11  1  0
 12  3  1  0
 13 12  1  0
 14 13  2  0
 15 14  1  0
 16 15  1  0
 17 16  1  0
 12 17  2  0
 16 18  1  0
 19 18  2  0
 20 19  1  0
 15 20  2  0
 19 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 21 27  2  0
 14 28  1  0
 29 28  1  0
 30 29  1  0
 31 30  1  0
 32 31  1  0
 33 32  1  0
 28 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4643948

    ---

Associated Targets(Human)

SJRH30 (203 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 463.46Molecular Weight (Monoisotopic): 463.1944AlogP: 2.76#Rotatable Bonds: 6
Polar Surface Area: 110.67Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 5.11CX LogP: 3.59CX LogD: 3.58
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.54Np Likeness Score: -1.31

References

1. Xiang HY, Chen YH, Wang Y, Zhang X, Ding J, Meng LH, Yang CH..  (2020)  Design, synthesis and antiproliferative activity evaluation of a series of pyrrolo[2,1-f][1,2,4]triazine derivatives.,  30  (12): [PMID:32317209] [10.1016/j.bmcl.2020.127194]

Source