Pentyl (((((S)-1-((4-aminopyrimidin-2-yl)oxy)propan-2-yl)oxy)methyl)(phenoxy)phosphoryl)-L-valinate

ID: ALA4643983

PubChem CID: 156018561

Max Phase: Preclinical

Molecular Formula: C24H37N4O6P

Molecular Weight: 508.56

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCOC(=O)[C@@H](NP(=O)(CO[C@@H](C)COc1nccc(N)n1)Oc1ccccc1)C(C)C

Standard InChI:  InChI=1S/C24H37N4O6P/c1-5-6-10-15-31-23(29)22(18(2)3)28-35(30,34-20-11-8-7-9-12-20)17-33-19(4)16-32-24-26-14-13-21(25)27-24/h7-9,11-14,18-19,22H,5-6,10,15-17H2,1-4H3,(H,28,30)(H2,25,26,27)/t19-,22-,35?/m0/s1

Standard InChI Key:  QNGHFZIGFMWRBF-LMQBDKFZSA-N

Molfile:  

 
     RDKit          2D

 35 36  0  0  0  0  0  0  0  0999 V2000
   19.1814  -22.8328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1803  -23.6601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8950  -24.0730    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.6115  -23.6596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6087  -22.8291    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.8933  -22.4200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8908  -21.5950    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.3267  -24.0710    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.3279  -24.8960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0430  -25.3073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0443  -26.1323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7569  -24.8937    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.4719  -25.3051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1858  -24.8915    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   24.9008  -25.3029    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.1844  -24.0665    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.1786  -25.7161    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.6146  -24.8893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3297  -25.3006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0435  -24.8870    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.3310  -26.1256    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.4693  -23.6551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4699  -22.8307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7555  -22.4193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0408  -22.8330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0447  -23.6622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7596  -24.0698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7586  -25.2984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4724  -24.8848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1876  -25.2961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9013  -24.8825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6133  -24.0643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3272  -23.6507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8982  -23.6529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6165  -25.2939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  4  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 10 12  1  1
 12 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  1  0
 14 17  2  0
 15 18  1  0
 18 19  1  0
 19 20  1  0
 19 21  2  0
 16 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 20 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 18 32  1  1
 32 33  1  0
 32 34  1  0
 31 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4643983

    ---

Associated Targets(Human)

HEL (6614 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Cytomegalovirus (1023 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Human alphaherpesvirus 3 (4092 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 508.56Molecular Weight (Monoisotopic): 508.2451AlogP: 4.42#Rotatable Bonds: 16
Polar Surface Area: 134.89Molecular Species: NEUTRALHBA: 9HBD: 2
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.34CX Basic pKa: 5.85CX LogP: 4.26CX LogD: 4.25
Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.19Np Likeness Score: -0.25

References

1. Luo M, Groaz E, Snoeck R, Andrei G, Herdewijn P..  (2020)  Amidate Prodrugs of O-2-Alkylated Pyrimidine Acyclic Nucleosides Display Potent Anti-Herpesvirus Activity.,  11  (7): [PMID:32676147] [10.1021/acsmedchemlett.0c00090]

Source