The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S)-2-[[(2S)-2-[[(2R)-1-[[5-(dimethylamino)-1-naphthyl]sulfonyl]pyrrolidine-2-carbonyl]amino]-4-phenyl-butanoyl]amino]-5-guanidino-pentanoic acid ID: ALA4644027
PubChem CID: 156018923
Max Phase: Preclinical
Molecular Formula: C33H43N7O6S
Molecular Weight: 665.82
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)c1cccc2c(S(=O)(=O)N3CCC[C@@H]3C(=O)N[C@@H](CCc3ccccc3)C(=O)N[C@@H](CCCNC(=N)N)C(=O)O)cccc12
Standard InChI: InChI=1S/C33H43N7O6S/c1-39(2)27-15-6-13-24-23(27)12-7-17-29(24)47(45,46)40-21-9-16-28(40)31(42)37-25(19-18-22-10-4-3-5-11-22)30(41)38-26(32(43)44)14-8-20-36-33(34)35/h3-7,10-13,15,17,25-26,28H,8-9,14,16,18-21H2,1-2H3,(H,37,42)(H,38,41)(H,43,44)(H4,34,35,36)/t25-,26-,28+/m0/s1
Standard InChI Key: KSPUMTJNNKKZAY-UNCTUWKVSA-N
Molfile:
RDKit 2D
47 50 0 0 0 0 0 0 0 0999 V2000
31.8966 -10.3941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6046 -9.9869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3129 -10.3935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3129 -11.2130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6072 -11.6236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8966 -11.2182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6072 -12.4431 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.3152 -12.8507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8991 -12.8507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0254 -11.6228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7293 -11.2135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7267 -10.3958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0182 -9.9883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0182 -9.1688 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
33.3102 -8.7612 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.5635 -9.0925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0160 -8.4832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4234 -7.7757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2251 -7.9446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8893 -7.4662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8078 -6.6527 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.5973 -7.8738 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.3054 -7.4662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0176 -7.8738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7257 -7.4662 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.4337 -7.8738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1418 -7.4662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8540 -7.8738 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.1418 -6.6467 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.4337 -8.6933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1418 -9.1051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1418 -9.9245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8540 -10.3322 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.5621 -9.9245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2701 -10.3322 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.5621 -9.1051 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.0176 -8.6933 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.3054 -6.6467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5973 -6.2390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5973 -5.4196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8894 -5.0075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8904 -4.1915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5988 -3.7837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3071 -4.1906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3097 -5.0094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8399 -9.1688 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.4300 -8.4608 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
5 7 1 0
7 8 1 0
7 9 1 0
4 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
3 13 1 0
13 14 1 0
14 15 1 0
16 15 1 0
16 17 1 0
17 18 1 0
18 19 1 0
15 19 1 0
19 20 1 6
20 21 2 0
20 22 1 0
23 22 1 1
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
27 29 2 0
26 30 1 6
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
34 36 2 0
24 37 2 0
23 38 1 0
38 39 1 0
39 40 1 0
41 40 2 0
42 41 1 0
43 42 2 0
44 43 1 0
45 44 2 0
40 45 1 0
14 46 2 0
14 47 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 665.82Molecular Weight (Monoisotopic): 665.2996AlogP: 2.01#Rotatable Bonds: 15Polar Surface Area: 198.02Molecular Species: ZWITTERIONHBA: 7HBD: 6#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 7#RO5 Violations (Lipinski): 3CX Acidic pKa: 3.64CX Basic pKa: 11.80CX LogP: 0.69CX LogD: 0.69Aromatic Rings: 3Heavy Atoms: 47QED Weighted: 0.08Np Likeness Score: -0.59
References 1. de la Sierra-Gallay IL, Belnou M, Chambraud B, Genet M, van Tilbeurgh H, Aumont-Nicaise M, Desmadril M, Baulieu EE, Jacquot Y, Byrne C.. (2020) Bioinspired Hybrid Fluorescent Ligands for the FK1 Domain of FKBP52., 63 (18): [PMID:32866001 ] [10.1021/acs.jmedchem.0c00825 ]