N-methyl-N-((1R,3S)-3-(5-(4-methyl-1H-imidazol-5-yl)-4H-1,2,4-triazol-3-yl)cyclohexyl)-3-(trifluoromethyl)benzamide

ID: ALA4644081

PubChem CID: 137285183

Max Phase: Preclinical

Molecular Formula: C21H23F3N6O

Molecular Weight: 432.45

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1nc[nH]c1-c1nnc([C@H]2CCC[C@@H](N(C)C(=O)c3cccc(C(F)(F)F)c3)C2)[nH]1

Standard InChI:  InChI=1S/C21H23F3N6O/c1-12-17(26-11-25-12)19-27-18(28-29-19)13-5-4-8-16(10-13)30(2)20(31)14-6-3-7-15(9-14)21(22,23)24/h3,6-7,9,11,13,16H,4-5,8,10H2,1-2H3,(H,25,26)(H,27,28,29)/t13-,16+/m0/s1

Standard InChI Key:  SURIPAFCVGJTMM-XJKSGUPXSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   24.9931   -3.5989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9919   -4.4184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7000   -4.8274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4096   -4.4180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4068   -3.5953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6982   -3.1900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1130   -3.1840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8222   -3.5900    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.1099   -2.3669    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.8253   -4.4072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5284   -3.1787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2401   -3.5896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9442   -3.1818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9454   -2.3643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2363   -1.9562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5260   -2.3656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6519   -3.5904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6998   -5.6446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9920   -6.0530    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   26.4074   -6.0534    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   25.6920   -6.4591    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   30.7367   -4.3997    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.5360   -4.5696    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.9446   -3.8619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3978   -3.2547    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.7578   -3.8590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2381   -4.5151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0106   -4.2610    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.0077   -3.4478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2334   -3.1994    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.9884   -5.2932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  7  9  2  0
  8 10  1  0
 11  8  1  6
 11 12  1  0
 11 16  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 13 17  1  6
  3 18  1  0
 18 19  1  0
 18 20  1  0
 18 21  1  0
 17 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 17  1  0
 24 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 26  1  0
 27 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4644081

    ---

Associated Targets(Human)

GPR142 Tchem Probable G-protein coupled receptor 142 (378 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 432.45Molecular Weight (Monoisotopic): 432.1885AlogP: 4.32#Rotatable Bonds: 4
Polar Surface Area: 90.56Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.02CX Basic pKa: 5.46CX LogP: 2.37CX LogD: 2.34
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.64Np Likeness Score: -1.12

References

1. Liu LZ, Ma T, Zhou J, Long Hu Z, Jun Zhang X, Zhen Zhang H, Zeng M, Liu J, Li L, Jiang Y, Zou Z, Wang F, Zhang L, Xu J, Wang J, Xiao F, Fang X, Zou H, Efanov AM, Thomas MK, Lin HV, Chen J..  (2020)  Discovery of LY3325656: A GPR142 agonist suitable for clinical testing in human.,  30  (5): [PMID:31982234] [10.1016/j.bmcl.2019.126857]
2.  (2019)  Cyclohexyl benzamide compounds,