The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
tert-butyl 4-(4'-cyanobiphenylcarbonyl)piperazine-1-carboxylate ID: ALA4644194
PubChem CID: 156018668
Max Phase: Preclinical
Molecular Formula: C23H25N3O3
Molecular Weight: 391.47
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)OC(=O)N1CCN(C(=O)c2ccc(-c3ccc(C#N)cc3)cc2)CC1
Standard InChI: InChI=1S/C23H25N3O3/c1-23(2,3)29-22(28)26-14-12-25(13-15-26)21(27)20-10-8-19(9-11-20)18-6-4-17(16-24)5-7-18/h4-11H,12-15H2,1-3H3
Standard InChI Key: NIHIIBHPFAUJMQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
28.1106 -11.9665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1095 -12.7938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8242 -13.2067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5407 -12.7933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5378 -11.9628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8224 -11.5537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3965 -13.2060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6821 -12.7911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9678 -13.2024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9667 -14.0283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6859 -14.4412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3972 -14.0276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2574 -14.4434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5433 -14.8562 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.2507 -11.5476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2476 -10.7226 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.9667 -11.9574 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.9698 -12.7824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6796 -11.5422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3956 -11.9520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3987 -12.7770 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.1148 -13.1868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6859 -13.1921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1178 -14.0118 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.8276 -12.7717 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.5437 -13.1814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2565 -12.7662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5467 -14.0064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2536 -13.5914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
2 7 1 0
13 14 3 0
10 13 1 0
5 15 1 0
15 16 2 0
15 17 1 0
17 18 1 0
17 19 1 0
19 20 1 0
18 23 1 0
20 21 1 0
21 22 1 0
21 23 1 0
22 24 2 0
22 25 1 0
25 26 1 0
26 27 1 0
26 28 1 0
26 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 391.47Molecular Weight (Monoisotopic): 391.1896AlogP: 3.92#Rotatable Bonds: 2Polar Surface Area: 73.64Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.52CX LogD: 3.52Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.78Np Likeness Score: -1.25
References 1. Hou Z, Min W, Zhang R, Niu A, Li Y, Cao L, Han J, Luo C, Yang P, Ding H.. (2020) Lead discovery, chemical optimization, and biological evaluation studies of novel histone methyltransferase SET7 small-molecule inhibitors., 30 (9): [PMID:32173197 ] [10.1016/j.bmcl.2020.127061 ]