O-((41S,13aS)-13a-ethyl-2,3,41,5,6,13a-hexahydro-1H-indolo[3,2,1-de]pyrido[3,2,1-ij][1,5]naphthyridin-12-yl)methyl S-methyl 3-fluorophenylcarbonimidothioate

ID: ALA4644211

PubChem CID: 156018802

Max Phase: Preclinical

Molecular Formula: C28H30FN3OS

Molecular Weight: 475.63

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC[C@@]12C=C(CO/C(=N/c3cccc(F)c3)SC)n3c4c(c5ccccc53)CCN(CCC1)[C@H]42

Standard InChI:  InChI=1S/C28H30FN3OS/c1-3-28-13-7-14-31-15-12-23-22-10-4-5-11-24(22)32(25(23)26(28)31)21(17-28)18-33-27(34-2)30-20-9-6-8-19(29)16-20/h4-6,8-11,16-17,26H,3,7,12-15,18H2,1-2H3/b30-27-/t26-,28+/m1/s1

Standard InChI Key:  INJGVYQYSAACJC-IXUGJBATSA-N

Molfile:  

 
     RDKit          2D

 35 40  0  0  0  0  0  0  0  0999 V2000
   35.7223   -3.2956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1501   -3.2956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4362   -2.8777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7223   -4.1228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0148   -5.3564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7287   -5.7658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4322   -4.5322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4425   -5.3529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1544   -5.7520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8606   -5.3350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8502   -4.5143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1338   -4.1107    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.0153   -4.5366    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.2989   -5.7708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5820   -5.3580    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.4539   -3.7214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9315   -3.0505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5891   -2.3036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7694   -2.2263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2933   -2.9022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6384   -3.6464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4260   -3.7015    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   36.4344   -6.1790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1466   -6.5995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8661   -5.7724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1493   -5.3595    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.8670   -6.5995    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   31.4334   -5.7740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7171   -5.3585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0018   -5.7722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0022   -6.6004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7241   -7.0129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4365   -6.5969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5839   -7.0123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2851   -5.3591    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  4  2  0
  1  3  1  0
 12  2  1  0
  2  3  1  0
  7  4  1  0
 13  5  1  0
  5  6  2  0
  6  8  1  0
  7  8  1  0
  7 12  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 13  4  1  0
  1 17  1  0
 16 13  1  0
  5 14  1  0
 14 15  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
  7 22  1  6
  8 23  1  6
 23 24  1  0
 15 25  1  0
 25 26  2  0
 25 27  1  0
 26 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 27 34  1  0
 30 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4644211

    ---

Associated Targets(Human)

PDE1A Tclin Phosphodiesterase 1A (251 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 475.63Molecular Weight (Monoisotopic): 475.2094AlogP: 6.79#Rotatable Bonds: 4
Polar Surface Area: 29.76Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 7.08CX LogP: 6.94CX LogD: 6.78
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.31Np Likeness Score: 0.13

References

1. Pan BW, Shi Y, Li WC, Wang Q, Pan M, Wu Q, Fu HZ..  (2020)  Synthesis and biological evaluation of Vinpocetine derivatives.,  30  (2): [PMID:31859156] [10.1016/j.bmcl.2019.05.052]

Source