The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-methyl-N-(1-(2-((1-methyl-1H-pyrazol-5-yl)amino)benzoyl)piperidin-4-yl)-2-trifluoromethyl-4-fluoro-benzamide ID: ALA4644288
PubChem CID: 147359459
Max Phase: Preclinical
Molecular Formula: C25H25F4N5O2
Molecular Weight: 503.50
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(C(=O)c1ccc(F)cc1C(F)(F)F)C1CCN(C(=O)c2ccccc2Nc2ccnn2C)CC1
Standard InChI: InChI=1S/C25H25F4N5O2/c1-32(23(35)18-8-7-16(26)15-20(18)25(27,28)29)17-10-13-34(14-11-17)24(36)19-5-3-4-6-21(19)31-22-9-12-30-33(22)2/h3-9,12,15,17,31H,10-11,13-14H2,1-2H3
Standard InChI Key: DGYPDRAGFZNVOC-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
11.6958 -7.7197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5211 -7.7208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9350 -7.0072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5206 -6.2920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6922 -6.2949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2862 -7.0090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2845 -8.4366 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.9362 -8.4381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5200 -9.1504 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.7633 -8.4387 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.1706 -9.1532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9941 -9.1558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4142 -8.4453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0003 -7.7263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1706 -7.7219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2413 -8.4490 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.6494 -9.1636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6560 -7.7340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2347 -9.8785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4765 -9.1674 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.4097 -9.8719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9909 -10.5860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4033 -11.3057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2347 -11.3068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6456 -10.5921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4615 -8.4390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9902 -12.0175 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
17.4685 -10.5918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8802 -11.3044 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
17.8798 -9.8790 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
18.2878 -10.5903 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.9747 -7.7757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1927 -8.0321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1949 -8.8552 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.9783 -9.1071 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.2347 -9.8892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 1 0
2 8 1 0
8 9 2 0
8 10 1 0
10 11 1 0
10 15 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
13 16 1 0
16 17 1 0
16 18 1 0
17 19 1 0
17 20 2 0
19 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 19 1 0
7 26 1 0
23 27 1 0
25 28 1 0
28 29 1 0
28 30 1 0
28 31 1 0
26 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 26 1 0
35 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 503.50Molecular Weight (Monoisotopic): 503.1944AlogP: 4.70#Rotatable Bonds: 5Polar Surface Area: 70.47Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 3.26CX LogP: 4.66CX LogD: 4.66Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.51Np Likeness Score: -1.97
References 1. Ji D, Zhang W, Xu Y, Zhang JJ.. (2020) Design, synthesis and biological evaluation of anthranilamide derivatives as potent SMO inhibitors., 28 (6): [PMID:32063403 ] [10.1016/j.bmc.2020.115354 ]