The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
cis-3-(4-chlorophenoxy)-1-(4-((4,6-dimorpholino-1,3,5-triazin-2-yl)amino)phenyl)-4-(4-nitrophenyl)azetidin-2-one ID: ALA4644296
PubChem CID: 156017836
Max Phase: Preclinical
Molecular Formula: C32H31ClN8O6
Molecular Weight: 659.10
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C1[C@@H](Oc2ccc(Cl)cc2)[C@@H](c2ccc([N+](=O)[O-])cc2)N1c1ccc(Nc2nc(N3CCOCC3)nc(N3CCOCC3)n2)cc1
Standard InChI: InChI=1S/C32H31ClN8O6/c33-22-3-11-26(12-4-22)47-28-27(21-1-7-25(8-2-21)41(43)44)40(29(28)42)24-9-5-23(6-10-24)34-30-35-31(38-13-17-45-18-14-38)37-32(36-30)39-15-19-46-20-16-39/h1-12,27-28H,13-20H2,(H,34,35,36,37)/t27-,28+/m1/s1
Standard InChI Key: PFQKPJKNFWOTFE-IZLXSDGUSA-N
Molfile:
RDKit 2D
47 53 0 0 0 0 0 0 0 0999 V2000
5.2828 -25.3081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2828 -26.1253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1000 -26.1253 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1000 -25.3081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6779 -24.7303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7050 -24.7303 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7050 -26.7032 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9156 -24.9418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4636 -24.9437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0411 -24.3666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8298 -23.5763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0357 -23.3663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4616 -23.9448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3389 -24.3627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5502 -24.5737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3380 -25.3638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9207 -25.9427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7072 -25.7287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4066 -22.9934 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1941 -22.2043 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1962 -23.2038 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6765 -26.7028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4634 -27.4928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0405 -28.0704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8308 -27.8591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0408 -27.0650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4623 -26.4908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4094 -28.4362 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1984 -28.2236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7755 -28.8014 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5640 -28.5894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7751 -27.7991 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1916 -27.2209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4054 -27.4359 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.1403 -29.1620 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.9273 -29.9519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5017 -30.5281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2923 -30.3199 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5053 -29.5300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9277 -28.9482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3960 -26.4345 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.1857 -26.2208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3944 -25.4344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8165 -24.8562 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0267 -25.0699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8149 -25.8618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5489 -25.5763 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 1 1 0
4 5 1 1
1 6 1 1
2 7 2 0
6 8 1 0
5 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 5 1 0
8 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 8 1 0
19 20 2 0
19 21 1 0
11 19 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
3 22 1 0
25 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
35 36 1 0
35 40 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
31 35 1 0
41 42 1 0
41 46 1 0
42 43 1 0
43 44 1 0
44 45 1 0
45 46 1 0
33 41 1 0
16 47 1 0
M CHG 2 19 1 21 -1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 659.10Molecular Weight (Monoisotopic): 658.2055AlogP: 4.39#Rotatable Bonds: 9Polar Surface Area: 148.32Molecular Species: NEUTRALHBA: 12HBD: 1#RO5 Violations: 2HBA (Lipinski): 14HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.49CX Basic pKa: 7.33CX LogP: 6.10CX LogD: 5.83Aromatic Rings: 4Heavy Atoms: 47QED Weighted: 0.15Np Likeness Score: -1.15
References 1. Ranjbari S, Behzadi M, Sepehri S, Dadkhah Aseman M, Jarrahpour A, Mohkam M, Ghasemi Y, Reza Akbarizadeh A, Kianpour S, Atioğlu Z, Özdemir N, Akkurt M, Masoud Nabavizadeh S, Turos E.. (2020) Investigations of antiproliferative and antioxidant activity of β-lactam morpholino-1,3,5-triazine hybrids., 28 (8): [PMID:32165076 ] [10.1016/j.bmc.2020.115408 ]