The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
cis-3-(4-chlorophenoxy)-4-(4-chlorophenyl)-1-(4-((4,6-dimorpholino-1,3,5-triazin-2-yl)amino)phenyl)azetidin-2-one ID: ALA4644599
PubChem CID: 156018468
Max Phase: Preclinical
Molecular Formula: C32H31Cl2N7O4
Molecular Weight: 648.55
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C1[C@@H](Oc2ccc(Cl)cc2)[C@@H](c2ccc(Cl)cc2)N1c1ccc(Nc2nc(N3CCOCC3)nc(N3CCOCC3)n2)cc1
Standard InChI: InChI=1S/C32H31Cl2N7O4/c33-22-3-1-21(2-4-22)27-28(45-26-11-5-23(34)6-12-26)29(42)41(27)25-9-7-24(8-10-25)35-30-36-31(39-13-17-43-18-14-39)38-32(37-30)40-15-19-44-20-16-40/h1-12,27-28H,13-20H2,(H,35,36,37,38)/t27-,28+/m1/s1
Standard InChI Key: RZHMGLOJKSOMRW-IZLXSDGUSA-N
Molfile:
RDKit 2D
45 51 0 0 0 0 0 0 0 0999 V2000
20.2482 -25.3040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2482 -26.1212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0653 -26.1212 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.0653 -25.3040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6432 -24.7262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6703 -24.7262 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.6703 -26.6990 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.8810 -24.9377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4289 -24.9396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0065 -24.3625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7952 -23.5722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0011 -23.3621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4269 -23.9407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3042 -24.3586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5155 -24.5696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3033 -25.3596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8860 -25.9386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6725 -25.7246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6418 -26.6986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4287 -27.4887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0058 -28.0663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7961 -27.8550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0062 -27.0608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4276 -26.4867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3747 -28.4320 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.1638 -28.2195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7409 -28.7973 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.5293 -28.5853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7404 -27.7949 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.1569 -27.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3707 -27.4318 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.1056 -29.1578 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.8927 -29.9478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4671 -30.5240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2577 -30.3158 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.4706 -29.5259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8930 -28.9441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3613 -26.4304 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.1511 -26.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3597 -25.4303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7818 -24.8520 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.9921 -25.0657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7802 -25.8577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5143 -25.5722 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
23.3722 -22.9936 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 1 1 0
4 5 1 1
1 6 1 1
2 7 2 0
6 8 1 0
5 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 5 1 0
8 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 8 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
3 19 1 0
22 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
32 33 1 0
32 37 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
28 32 1 0
38 39 1 0
38 43 1 0
39 40 1 0
40 41 1 0
41 42 1 0
42 43 1 0
30 38 1 0
16 44 1 0
11 45 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 648.55Molecular Weight (Monoisotopic): 647.1815AlogP: 5.13#Rotatable Bonds: 8Polar Surface Area: 105.18Molecular Species: NEUTRALHBA: 10HBD: 1#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 1#RO5 Violations (Lipinski): 3CX Acidic pKa: 9.49CX Basic pKa: 7.33CX LogP: 6.76CX LogD: 6.49Aromatic Rings: 4Heavy Atoms: 45QED Weighted: 0.26Np Likeness Score: -0.95
References 1. Ranjbari S, Behzadi M, Sepehri S, Dadkhah Aseman M, Jarrahpour A, Mohkam M, Ghasemi Y, Reza Akbarizadeh A, Kianpour S, Atioğlu Z, Özdemir N, Akkurt M, Masoud Nabavizadeh S, Turos E.. (2020) Investigations of antiproliferative and antioxidant activity of β-lactam morpholino-1,3,5-triazine hybrids., 28 (8): [PMID:32165076 ] [10.1016/j.bmc.2020.115408 ]