[2-[6-amino-4-(trifluoromethyl)-3-pyridyl]-7-methyl-4-morpholino-pyrrolo[2,1-f][1,2,4]triazin-6-yl]-[4-(dimethylamino)-1-piperidyl]methanone

ID: ALA4644602

PubChem CID: 156018470

Max Phase: Preclinical

Molecular Formula: C25H31F3N8O2

Molecular Weight: 532.57

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1c(C(=O)N2CCC(N(C)C)CC2)cc2c(N3CCOCC3)nc(-c3cnc(N)cc3C(F)(F)F)nn12

Standard InChI:  InChI=1S/C25H31F3N8O2/c1-15-17(24(37)35-6-4-16(5-7-35)33(2)3)12-20-23(34-8-10-38-11-9-34)31-22(32-36(15)20)18-14-30-21(29)13-19(18)25(26,27)28/h12-14,16H,4-11H2,1-3H3,(H2,29,30)

Standard InChI Key:  AQPRYXFAOBRUKB-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
    1.9448  -16.4981    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6570  -16.0867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3653  -16.4975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3653  -17.3211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6595  -17.7317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9448  -17.3222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2377  -17.7311    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0724  -17.7299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7796  -17.3211    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.0724  -18.5477    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.7796  -18.1388    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.0775  -16.0857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0778  -15.2662    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7875  -14.8571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5000  -15.2690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4981  -16.0868    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7899  -16.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2801  -16.3372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7564  -15.6746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2765  -15.0144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5741  -15.6746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9830  -14.9674    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.5741  -14.2562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9830  -13.5491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8007  -13.5491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2096  -14.2562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8007  -14.9674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2096  -12.8420    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.8007  -12.1348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0274  -12.8420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9830  -16.3817    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4907  -17.1277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7875  -14.0393    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0804  -13.6305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0804  -12.8128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7875  -12.4039    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4947  -12.8127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4946  -13.6304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  6  7  1  0
  4  8  1  0
  8  9  1  0
  8 10  1  0
  8 11  1  0
 12  3  1  0
 13 12  1  0
 14 13  2  0
 15 14  1  0
 16 15  1  0
 17 16  1  0
 12 17  2  0
 16 18  1  0
 19 18  2  0
 20 19  1  0
 15 20  2  0
 19 21  1  0
 21 22  1  0
 23 22  1  0
 24 23  1  0
 25 24  1  0
 26 25  1  0
 27 26  1  0
 22 27  1  0
 25 28  1  0
 28 29  1  0
 28 30  1  0
 21 31  2  0
 18 32  1  0
 14 33  1  0
 34 33  1  0
 35 34  1  0
 36 35  1  0
 37 36  1  0
 38 37  1  0
 33 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4644602

    ---

Associated Targets(Human)

SJRH30 (203 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 532.57Molecular Weight (Monoisotopic): 532.2522AlogP: 2.70#Rotatable Bonds: 4
Polar Surface Area: 105.12Molecular Species: BASEHBA: 9HBD: 1
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 9.68CX LogP: 2.75CX LogD: 0.48
Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.55Np Likeness Score: -1.42

References

1. Xiang HY, Chen YH, Wang Y, Zhang X, Ding J, Meng LH, Yang CH..  (2020)  Design, synthesis and antiproliferative activity evaluation of a series of pyrrolo[2,1-f][1,2,4]triazine derivatives.,  30  (12): [PMID:32317209] [10.1016/j.bmcl.2020.127194]

Source