Pentyl (((((S)-1-((4-amino-5-fluoropyrimidin-2-yl)oxy)-3-fluoropropan-2-yl)oxy)methyl)(phenoxy)phosphoryl)-L-valinate

ID: ALA4644861

PubChem CID: 156018828

Max Phase: Preclinical

Molecular Formula: C24H35F2N4O6P

Molecular Weight: 544.54

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCOC(=O)[C@@H](NP(=O)(CO[C@H](CF)COc1ncc(F)c(N)n1)Oc1ccccc1)C(C)C

Standard InChI:  InChI=1S/C24H35F2N4O6P/c1-4-5-9-12-33-23(31)21(17(2)3)30-37(32,36-18-10-7-6-8-11-18)16-35-19(13-25)15-34-24-28-14-20(26)22(27)29-24/h6-8,10-11,14,17,19,21H,4-5,9,12-13,15-16H2,1-3H3,(H,30,32)(H2,27,28,29)/t19-,21+,37?/m1/s1

Standard InChI Key:  OOVUZLZGHMTXMD-FESYFXFASA-N

Molfile:  

 
     RDKit          2D

 37 38  0  0  0  0  0  0  0  0999 V2000
   18.9983  -21.6122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9972  -22.4395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7119  -22.8524    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.4284  -22.4391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4256  -21.6086    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.7102  -21.1994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7077  -20.3744    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.1436  -22.8504    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.1448  -23.6754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8599  -24.0868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8613  -24.9118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1474  -25.3254    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   22.5738  -23.6732    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.2889  -24.0846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0027  -23.6710    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   24.7178  -24.0824    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.0014  -22.8460    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.9955  -24.4956    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.4316  -23.6687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1467  -24.0801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8605  -23.6665    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.1480  -24.9050    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.2862  -22.4346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2868  -21.6101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5726  -21.1988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8577  -21.6124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8617  -22.4416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5765  -22.8493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5756  -24.0778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2894  -23.6642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0046  -24.0756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7183  -23.6620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4335  -24.0734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4303  -22.8437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1441  -22.4301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7152  -22.4324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2837  -21.1999    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  4  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 10 13  1  6
 13 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  1  0
 15 18  2  0
 16 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  2  0
 17 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 21 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 19 34  1  1
 34 35  1  0
 34 36  1  0
  1 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4644861

    ---

Associated Targets(Human)

HEL (6614 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Cytomegalovirus (1023 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Human alphaherpesvirus 3 (4092 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 544.54Molecular Weight (Monoisotopic): 544.2262AlogP: 4.51#Rotatable Bonds: 17
Polar Surface Area: 134.89Molecular Species: NEUTRALHBA: 9HBD: 2
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.34CX Basic pKa: 3.27CX LogP: 4.24CX LogD: 4.24
Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.17Np Likeness Score: -0.36

References

1. Luo M, Groaz E, Snoeck R, Andrei G, Herdewijn P..  (2020)  Amidate Prodrugs of O-2-Alkylated Pyrimidine Acyclic Nucleosides Display Potent Anti-Herpesvirus Activity.,  11  (7): [PMID:32676147] [10.1021/acsmedchemlett.0c00090]

Source