2-[1-[1-(5-phenylbenzothiophene-2-carbonyl)azetidin-3-yl]azetidin-3-yl]isoindolin-1-one

ID: ALA4645008

PubChem CID: 66605661

Max Phase: Preclinical

Molecular Formula: C29H25N3O2S

Molecular Weight: 479.61

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(c1cc2cc(-c3ccccc3)ccc2s1)N1CC(N2CC(N3Cc4ccccc4C3=O)C2)C1

Standard InChI:  InChI=1S/C29H25N3O2S/c33-28-25-9-5-4-8-21(25)14-32(28)24-17-30(18-24)23-15-31(16-23)29(34)27-13-22-12-20(10-11-26(22)35-27)19-6-2-1-3-7-19/h1-13,23-24H,14-18H2

Standard InChI Key:  GJZXRKZHLMJZPE-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 41  0  0  0  0  0  0  0  0999 V2000
    6.5216   -2.8236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9434   -3.4069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5267   -3.9851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1049   -3.4018    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.9279   -3.3981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5112   -3.9764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0894   -3.3931    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.5061   -2.8149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9066   -3.3895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3213   -4.0983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3150   -2.6770    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1204   -3.4105    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6341   -2.7501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6400   -4.0817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8562   -3.8310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8528   -3.0089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1403   -2.6025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4306   -3.0172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4380   -3.8424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1511   -4.2450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8820   -1.9714    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9971   -4.8489    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   11.1439   -4.1780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3193   -4.9802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6116   -5.3920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6153   -6.2090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3261   -6.6151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0345   -6.1983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0273   -5.3827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7435   -6.5994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7491   -7.4177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4594   -7.8202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1646   -7.4055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1550   -6.5841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4441   -6.1853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  1  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  5  1  0
  7  9  1  0
  9 10  1  0
  9 11  2  0
  2 12  1  0
 12 13  1  0
 13 16  1  0
 15 14  1  0
 14 12  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 13 21  2  0
 10 22  1  0
 22 25  1  0
 24 23  1  0
 23 10  2  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
 28 30  1  0
M  END

Associated Targets(non-human)

Mgll Monoglyceride lipase (465 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 479.61Molecular Weight (Monoisotopic): 479.1667AlogP: 4.73#Rotatable Bonds: 4
Polar Surface Area: 43.86Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.74CX LogP: 4.57CX LogD: 4.57
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.43Np Likeness Score: -0.98

References

1. Zhu B, Connolly PJ, Zhang SP, Chevalier KM, Milligan CM, Flores CM, Macielag MJ..  (2020)  The discovery of diazetidinyl diamides as potent and reversible inhibitors of monoacylglycerol lipase (MAGL).,  30  (12): [PMID:32334914] [10.1016/j.bmcl.2020.127198]

Source