The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
[2-[6-amino-4-(trifluoromethyl)-3-pyridyl]-4-morpholino-pyrrolo[2,1-f][1,2,4]triazin-6-yl]-morpholino-methanone ID: ALA4645159
PubChem CID: 156018372
Max Phase: Preclinical
Molecular Formula: C21H22F3N7O3
Molecular Weight: 477.45
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Nc1cc(C(F)(F)F)c(-c2nc(N3CCOCC3)c3cc(C(=O)N4CCOCC4)cn3n2)cn1
Standard InChI: InChI=1S/C21H22F3N7O3/c22-21(23,24)15-10-17(25)26-11-14(15)18-27-19(29-1-5-33-6-2-29)16-9-13(12-31(16)28-18)20(32)30-3-7-34-8-4-30/h9-12H,1-8H2,(H2,25,26)
Standard InChI Key: FZXPLNCCIKMNQS-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
32.9326 -7.2136 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.6447 -6.8023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3530 -7.2131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3530 -8.0367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6473 -8.4473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9326 -8.0378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2254 -8.4466 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.0643 -8.4455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7714 -8.0367 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
35.0643 -9.2633 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
35.7714 -8.8544 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
35.0652 -6.8013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0655 -5.9817 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.7752 -5.5727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4877 -5.9805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4900 -6.7983 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.7818 -7.2156 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.2678 -7.0528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7441 -6.3902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2643 -5.7300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5619 -6.3902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9707 -5.6830 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.5619 -4.9718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9707 -4.2647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7885 -4.2647 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.1974 -4.9718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7885 -5.6830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9707 -7.0973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.7752 -4.7549 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.0681 -4.3461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0681 -3.5283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7753 -3.1195 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.4824 -3.5283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4824 -4.3460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
6 7 1 0
4 8 1 0
8 9 1 0
8 10 1 0
8 11 1 0
12 3 1 0
13 12 1 0
14 13 2 0
15 14 1 0
16 15 1 0
17 16 1 0
12 17 2 0
16 18 1 0
19 18 2 0
20 19 1 0
15 20 2 0
19 21 1 0
21 22 1 0
23 22 1 0
24 23 1 0
25 24 1 0
26 25 1 0
27 26 1 0
22 27 1 0
21 28 2 0
14 29 1 0
30 29 1 0
31 30 1 0
32 31 1 0
33 32 1 0
34 33 1 0
29 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 477.45Molecular Weight (Monoisotopic): 477.1736AlogP: 1.70#Rotatable Bonds: 3Polar Surface Area: 111.11Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 5.11CX LogP: 2.27CX LogD: 2.26Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.61Np Likeness Score: -1.36
References 1. Xiang HY, Chen YH, Wang Y, Zhang X, Ding J, Meng LH, Yang CH.. (2020) Design, synthesis and antiproliferative activity evaluation of a series of pyrrolo[2,1-f][1,2,4]triazine derivatives., 30 (12): [PMID:32317209 ] [10.1016/j.bmcl.2020.127194 ]