[2-[6-amino-4-(trifluoromethyl)-3-pyridyl]-4-morpholino-pyrrolo[2,1-f][1,2,4]triazin-6-yl]-morpholino-methanone

ID: ALA4645159

PubChem CID: 156018372

Max Phase: Preclinical

Molecular Formula: C21H22F3N7O3

Molecular Weight: 477.45

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Nc1cc(C(F)(F)F)c(-c2nc(N3CCOCC3)c3cc(C(=O)N4CCOCC4)cn3n2)cn1

Standard InChI:  InChI=1S/C21H22F3N7O3/c22-21(23,24)15-10-17(25)26-11-14(15)18-27-19(29-1-5-33-6-2-29)16-9-13(12-31(16)28-18)20(32)30-3-7-34-8-4-30/h9-12H,1-8H2,(H2,25,26)

Standard InChI Key:  FZXPLNCCIKMNQS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   32.9326   -7.2136    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.6447   -6.8023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3530   -7.2131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3530   -8.0367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6473   -8.4473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9326   -8.0378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2254   -8.4466    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.0643   -8.4455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7714   -8.0367    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   35.0643   -9.2633    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   35.7714   -8.8544    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   35.0652   -6.8013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0655   -5.9817    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.7752   -5.5727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4877   -5.9805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4900   -6.7983    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.7818   -7.2156    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.2678   -7.0528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7441   -6.3902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2643   -5.7300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5619   -6.3902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9707   -5.6830    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.5619   -4.9718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9707   -4.2647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7885   -4.2647    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.1974   -4.9718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7885   -5.6830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9707   -7.0973    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.7752   -4.7549    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.0681   -4.3461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0681   -3.5283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7753   -3.1195    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.4824   -3.5283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4824   -4.3460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  6  7  1  0
  4  8  1  0
  8  9  1  0
  8 10  1  0
  8 11  1  0
 12  3  1  0
 13 12  1  0
 14 13  2  0
 15 14  1  0
 16 15  1  0
 17 16  1  0
 12 17  2  0
 16 18  1  0
 19 18  2  0
 20 19  1  0
 15 20  2  0
 19 21  1  0
 21 22  1  0
 23 22  1  0
 24 23  1  0
 25 24  1  0
 26 25  1  0
 27 26  1  0
 22 27  1  0
 21 28  2  0
 14 29  1  0
 30 29  1  0
 31 30  1  0
 32 31  1  0
 33 32  1  0
 34 33  1  0
 29 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4645159

    ---

Associated Targets(Human)

SJRH30 (203 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 477.45Molecular Weight (Monoisotopic): 477.1736AlogP: 1.70#Rotatable Bonds: 3
Polar Surface Area: 111.11Molecular Species: NEUTRALHBA: 9HBD: 1
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 5.11CX LogP: 2.27CX LogD: 2.26
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.61Np Likeness Score: -1.36

References

1. Xiang HY, Chen YH, Wang Y, Zhang X, Ding J, Meng LH, Yang CH..  (2020)  Design, synthesis and antiproliferative activity evaluation of a series of pyrrolo[2,1-f][1,2,4]triazine derivatives.,  30  (12): [PMID:32317209] [10.1016/j.bmcl.2020.127194]

Source