The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-chloro-N2-[5-(4-methylpiperazin-1-yl)-2-pyridyl]-N4-[4-(trifluoromethoxy)phenyl]pyrimidine-2,4-diamine ID: ALA4645617
PubChem CID: 155665837
Max Phase: Preclinical
Molecular Formula: C21H21ClF3N7O
Molecular Weight: 479.89
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN1CCN(c2ccc(Nc3ncc(Cl)c(Nc4ccc(OC(F)(F)F)cc4)n3)nc2)CC1
Standard InChI: InChI=1S/C21H21ClF3N7O/c1-31-8-10-32(11-9-31)15-4-7-18(26-12-15)29-20-27-13-17(22)19(30-20)28-14-2-5-16(6-3-14)33-21(23,24)25/h2-7,12-13H,8-11H2,1H3,(H2,26,27,28,29,30)
Standard InChI Key: GVNBXUWQTFPDDE-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
34.8258 -6.1289 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
34.2548 -5.8003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2548 -4.9746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5423 -4.5639 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.8296 -4.9746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1111 -4.5655 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.3987 -4.9780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6840 -4.5667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.9732 -4.9810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9732 -5.8067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2621 -6.2212 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.5464 -5.8113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8383 -6.2272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8383 -7.0528 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.2698 -7.3855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5539 -7.4586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2621 -7.0468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6920 -6.2181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3987 -5.7998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8296 -5.8003 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.5423 -6.2111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5423 -7.0374 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.8259 -7.4471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8259 -8.2727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1071 -8.6801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3924 -8.2659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6801 -8.6756 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.9656 -8.2596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3921 -8.5840 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
29.9656 -7.5984 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
29.3971 -7.9268 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
31.3924 -7.4402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1151 -7.0329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
14 16 1 0
16 17 1 0
17 11 1 0
10 18 1 0
18 19 2 0
19 7 1 0
5 20 1 0
20 21 2 0
21 2 1 0
21 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 1 0
28 29 1 0
28 30 1 0
28 31 1 0
26 32 1 0
32 33 2 0
33 23 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 479.89Molecular Weight (Monoisotopic): 479.1448AlogP: 4.66#Rotatable Bonds: 6Polar Surface Area: 78.44Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.64CX Basic pKa: 7.65CX LogP: 5.57CX LogD: 5.13Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.53Np Likeness Score: -1.67
References 1. Wang Y, Chen X, Yan Y, Zhu X, Liu M, Liu X.. (2020) Discovery and SARs of 5-Chloro-N4-phenyl-N2-(pyridin-2-yl)pyrimidine-2,4-diamine Derivatives as Oral Available and Dual CDK 6 and 9 Inhibitors with Potent Antitumor Activity., 63 (6): [PMID:32129996 ] [10.1021/acs.jmedchem.9b02121 ]