The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-(6-bromo-2-oxo-2H-chromen-3-yl)-1-ethyl-6-fluoro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid ID: ALA4645656
PubChem CID: 156019593
Max Phase: Preclinical
Molecular Formula: C21H13BrFNO5
Molecular Weight: 458.24
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCn1cc(C(=O)O)c(=O)c2cc(F)c(-c3cc4cc(Br)ccc4oc3=O)cc21
Standard InChI: InChI=1S/C21H13BrFNO5/c1-2-24-9-15(20(26)27)19(25)14-7-16(23)12(8-17(14)24)13-6-10-5-11(22)3-4-18(10)29-21(13)28/h3-9H,2H2,1H3,(H,26,27)
Standard InChI Key: WXKZKZMXNMUJIN-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
7.5844 -24.3506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5833 -25.1701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2913 -25.5791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2895 -23.9418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9982 -24.3470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9970 -25.1722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7071 -25.5835 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4229 -25.1743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4241 -24.3491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7094 -23.9332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7095 -23.1160 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.1328 -23.9422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1348 -23.1250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8766 -23.9422 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.7048 -26.4007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8395 -24.3525 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4113 -26.8113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8788 -25.5759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1716 -25.1646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1680 -26.7980 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8801 -26.3918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4608 -26.3867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4694 -25.5719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7692 -25.1589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0600 -25.5595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0553 -26.3774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7561 -26.7867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5871 -26.8017 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3554 -25.1456 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
9 12 1 0
12 13 2 0
1 14 1 0
7 15 1 0
12 16 1 0
15 17 1 0
18 19 2 0
18 21 1 0
19 23 1 0
22 20 1 0
20 21 1 0
2 18 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
21 28 2 0
25 29 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 458.24Molecular Weight (Monoisotopic): 456.9961AlogP: 4.39#Rotatable Bonds: 3Polar Surface Area: 89.51Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 5.55CX Basic pKa: ┄CX LogP: 4.12CX LogD: 2.27Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.46Np Likeness Score: -0.69
References 1. Suaifan GARY, Mohammed AAM.. (2019) Fluoroquinolones structural and medicinal developments (2013-2018): Where are we now?, 27 (14): [PMID:31182257 ] [10.1016/j.bmc.2019.05.038 ]