The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(3-(4-((4-(1H-Pyrazol-4-yl)phenyl)amino)-5,7-dihydrofuro[3,4-d]pyrimidin-2-yl)phenoxy)-N,N-diethylacetamide ID: ALA4645739
PubChem CID: 124159304
Max Phase: Preclinical
Molecular Formula: C27H28N6O3
Molecular Weight: 484.56
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)C(=O)COc1cccc(-c2nc3c(c(Nc4ccc(-c5cn[nH]c5)cc4)n2)COC3)c1
Standard InChI: InChI=1S/C27H28N6O3/c1-3-33(4-2)25(34)17-36-22-7-5-6-19(12-22)26-31-24-16-35-15-23(24)27(32-26)30-21-10-8-18(9-11-21)20-13-28-29-14-20/h5-14H,3-4,15-17H2,1-2H3,(H,28,29)(H,30,31,32)
Standard InChI Key: IUWZUAMUZGMEPY-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
3.4006 -6.3462 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1102 -5.9368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1074 -5.1100 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3988 -4.7006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3963 -3.8793 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1028 -3.4686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8138 -3.8774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5239 -3.4674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5219 -2.6452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8039 -2.2348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0967 -2.6513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2264 -2.2311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9785 -2.5644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5268 -1.9506 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.1110 -1.2405 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3084 -1.4139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8192 -6.3435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8191 -7.1659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5308 -7.5775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2429 -7.1636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2390 -6.3380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5268 -5.9343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9488 -5.9258 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6627 -6.3308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3724 -5.9186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3683 -5.0973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0822 -6.3236 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.7920 -5.9114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6884 -5.9373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6851 -5.1166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9034 -4.8674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4219 -5.5300 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9087 -6.1926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0905 -7.1449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8003 -7.5540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5059 -6.3164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 30 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 1 0
16 12 2 0
9 12 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
2 17 1 0
21 23 1 0
23 24 1 0
24 25 1 0
25 26 2 0
25 27 1 0
27 28 1 0
29 30 2 0
30 31 1 0
31 32 1 0
32 33 1 0
33 29 1 0
27 34 1 0
34 35 1 0
28 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 484.56Molecular Weight (Monoisotopic): 484.2223AlogP: 4.55#Rotatable Bonds: 9Polar Surface Area: 105.26Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 3.16CX LogP: 3.72CX LogD: 3.72Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.36Np Likeness Score: -1.59
References 1. Liu KG, Kim JI, Olszewski K, Barsotti AM, Morris K, Lamarque C, Yu X, Gaffney J, Feng XJ, Patel JP, Poyurovsky MV.. (2020) Discovery and Optimization of Glucose Uptake Inhibitors., 63 (10): [PMID:32282207 ] [10.1021/acs.jmedchem.9b02153 ]