The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(5-(3,6-dioxocyclohexa-1,4-dienyl)-2-(morpholinomethyl)phenyl)-4-nitrobenzenesulfonamide ID: ALA4645807
PubChem CID: 156019422
Max Phase: Preclinical
Molecular Formula: C23H21N3O7S
Molecular Weight: 483.50
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C1C=CC(=O)C(c2ccc(CN3CCOCC3)c(NS(=O)(=O)c3ccc([N+](=O)[O-])cc3)c2)=C1
Standard InChI: InChI=1S/C23H21N3O7S/c27-19-5-8-23(28)21(14-19)16-1-2-17(15-25-9-11-33-12-10-25)22(13-16)24-34(31,32)20-6-3-18(4-7-20)26(29)30/h1-8,13-14,24H,9-12,15H2
Standard InChI Key: GDHNIVUOAKJYSI-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
18.7542 -14.3572 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.1707 -15.0734 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
19.5827 -14.3546 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.3169 -14.2531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3157 -15.0798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0301 -15.4925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7461 -15.0793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7432 -14.2494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0283 -13.8405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6051 -15.4892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8915 -15.0742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1793 -15.4824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1744 -16.3071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8879 -16.7222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6064 -16.3124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8941 -14.2497 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.8844 -17.5466 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.4557 -13.8345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4607 -15.4905 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.8887 -15.4882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4525 -13.0100 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.1650 -12.5952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7370 -12.6005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7339 -11.7760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4464 -11.3612 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.1619 -11.7707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8838 -16.3159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6010 -16.7308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3203 -16.3162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3179 -15.4827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6001 -15.0716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0388 -16.7270 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.7524 -16.3141 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.0396 -17.5515 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
10 11 1 0
10 15 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 1 0
5 10 1 0
11 16 2 0
14 17 2 0
8 18 1 0
7 19 1 0
19 2 1 0
2 20 1 0
18 21 1 0
21 22 1 0
21 23 1 0
23 24 1 0
22 26 1 0
24 25 1 0
25 26 1 0
20 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 20 1 0
32 33 2 0
32 34 1 0
29 32 1 0
M CHG 2 32 1 34 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 483.50Molecular Weight (Monoisotopic): 483.1100AlogP: 2.32#Rotatable Bonds: 7Polar Surface Area: 135.92Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.11CX Basic pKa: 3.91CX LogP: 2.84CX LogD: 2.46Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.36Np Likeness Score: -1.01
References 1. Hou Z, Min W, Zhang R, Niu A, Li Y, Cao L, Han J, Luo C, Yang P, Ding H.. (2020) Lead discovery, chemical optimization, and biological evaluation studies of novel histone methyltransferase SET7 small-molecule inhibitors., 30 (9): [PMID:32173197 ] [10.1016/j.bmcl.2020.127061 ]