The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
tert-butyl 4-(2-(4-chlorophenylsulfonamido)-4-(3,6-dioxocyclohexa-1,4-dienyl)benzyl)piperazine-1-carboxylate ID: ALA4645963
PubChem CID: 156019207
Max Phase: Preclinical
Molecular Formula: C28H30ClN3O6S
Molecular Weight: 572.08
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)OC(=O)N1CCN(Cc2ccc(C3=CC(=O)C=CC3=O)cc2NS(=O)(=O)c2ccc(Cl)cc2)CC1
Standard InChI: InChI=1S/C28H30ClN3O6S/c1-28(2,3)38-27(35)32-14-12-31(13-15-32)18-20-5-4-19(24-17-22(33)8-11-26(24)34)16-25(20)30-39(36,37)23-9-6-21(29)7-10-23/h4-11,16-17,30H,12-15,18H2,1-3H3
Standard InChI Key: PQMPTOIHJKSFJJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
42.1106 -15.5410 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.5272 -16.2576 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
42.9395 -15.5385 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.6718 -15.4367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6706 -16.2641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3855 -16.6769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1018 -16.2636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0990 -15.4331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3836 -15.0240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9594 -16.6737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2455 -16.2585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5329 -16.6669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5279 -17.4922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2419 -17.9074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9607 -17.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2481 -15.4335 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.2384 -18.7324 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.8118 -15.0180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8170 -16.6750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.2458 -16.6728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8088 -14.1930 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.5216 -13.7778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0927 -13.7832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0896 -12.9583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8025 -12.5431 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.5186 -12.9529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2409 -17.5010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.9585 -17.9161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.6783 -17.5013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.6759 -16.6672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.9576 -16.2558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.7994 -11.7181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5123 -11.3030 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.0834 -11.3083 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.2282 -11.7127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.9412 -11.2976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2314 -12.5377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.9397 -12.1244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.3931 -17.9131 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
10 11 1 0
10 15 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 1 0
5 10 1 0
11 16 2 0
14 17 2 0
8 18 1 0
7 19 1 0
19 2 1 0
2 20 1 0
18 21 1 0
21 22 1 0
21 23 1 0
23 24 1 0
22 26 1 0
24 25 1 0
25 26 1 0
20 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 20 1 0
25 32 1 0
32 33 1 0
32 34 2 0
33 35 1 0
35 36 1 0
35 37 1 0
35 38 1 0
29 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 572.08Molecular Weight (Monoisotopic): 571.1544AlogP: 4.28#Rotatable Bonds: 6Polar Surface Area: 113.09Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.62CX Basic pKa: 4.04CX LogP: 4.47CX LogD: 4.30Aromatic Rings: 2Heavy Atoms: 39QED Weighted: 0.51Np Likeness Score: -0.94
References 1. Hou Z, Min W, Zhang R, Niu A, Li Y, Cao L, Han J, Luo C, Yang P, Ding H.. (2020) Lead discovery, chemical optimization, and biological evaluation studies of novel histone methyltransferase SET7 small-molecule inhibitors., 30 (9): [PMID:32173197 ] [10.1016/j.bmcl.2020.127061 ]