(R)-6-((1-(4-Chlorophenyl)ethyl)amino)-1-isopropyl-5-(pyridin-4-ylmethyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one

ID: ALA4646295

PubChem CID: 156019242

Max Phase: Preclinical

Molecular Formula: C22H23ClN6O

Molecular Weight: 422.92

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)n1ncc2c(=O)n(Cc3ccncc3)c(N[C@H](C)c3ccc(Cl)cc3)nc21

Standard InChI:  InChI=1S/C22H23ClN6O/c1-14(2)29-20-19(12-25-29)21(30)28(13-16-8-10-24-11-9-16)22(27-20)26-15(3)17-4-6-18(23)7-5-17/h4-12,14-15H,13H2,1-3H3,(H,26,27)/t15-/m1/s1

Standard InChI Key:  JOTFHRWSLZLGOT-OAHLLOKOSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   18.5065  -24.0576    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.5065  -24.8789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2118  -25.2834    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.2118  -23.6408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9212  -24.0576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9211  -24.8754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6991  -25.1269    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.1816  -24.4645    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.6992  -23.8022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2118  -22.8194    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.7967  -23.6526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0911  -24.0648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3846  -23.6583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3979  -25.2926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1001  -24.8788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9508  -25.9007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7994  -25.2886    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.8006  -26.1057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0934  -26.5154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3887  -26.1037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6820  -26.5126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6828  -27.3307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3961  -27.7381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0998  -27.3268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9762  -27.7412    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   18.5089  -26.5133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4041  -26.5081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7501  -26.0704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6832  -24.8878    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.6751  -24.0654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  2  0
  3  6  1  0
  5  4  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  4 10  2  0
  1 11  1  0
 11 12  1  0
 12 13  2  0
 13 30  1  0
 29 14  1  0
 14 15  2  0
 15 12  1  0
  7 16  1  0
  2 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 22 25  1  0
 18 26  1  6
 16 27  1  0
 16 28  1  0
 29 30  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4646295

    ---

Associated Targets(Human)

PDE1C Tclin Phosphodiesterase 1C (228 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 422.92Molecular Weight (Monoisotopic): 422.1622AlogP: 4.44#Rotatable Bonds: 6
Polar Surface Area: 77.63Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 5.02CX LogP: 3.54CX LogD: 3.54
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.50Np Likeness Score: -1.88

References

1. Wu Y, Tian YJ, Le ML, Zhang SR, Zhang C, Huang MX, Jiang MY, Zhang B, Luo HB..  (2020)  Discovery of Novel Selective and Orally Bioavailable Phosphodiesterase-1 Inhibitors for the Efficient Treatment of Idiopathic Pulmonary Fibrosis.,  63  (14): [PMID:32603117] [10.1021/acs.jmedchem.0c00711]

Source