The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[4-[(5,11-dimethyl-6-oxo-pyrimido[4,5-b][1,4]benzodiazepin-2-yl)amino]phenyl]methanesulfonamide ID: ALA4646447
PubChem CID: 118687444
Max Phase: Preclinical
Molecular Formula: C20H20N6O3S
Molecular Weight: 424.49
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CN1C(=O)c2ccccc2N(C)c2nc(Nc3ccc(NS(C)(=O)=O)cc3)ncc21
Standard InChI: InChI=1S/C20H20N6O3S/c1-25-16-7-5-4-6-15(16)19(27)26(2)17-12-21-20(23-18(17)25)22-13-8-10-14(11-9-13)24-30(3,28)29/h4-12,24H,1-3H3,(H,21,22,23)
Standard InChI Key: CAIZEMRPVOVGGT-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
18.7786 -12.9932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3795 -13.5617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1245 -13.2178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1245 -12.3898 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.8689 -13.5816 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.4519 -12.9986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0440 -14.3865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8504 -14.5230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1372 -15.2888 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.6192 -15.9193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8325 -16.7196 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.6287 -16.9328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8431 -17.7339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6446 -17.9404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2219 -17.3599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0222 -17.5731 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.6052 -16.9901 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
26.4056 -17.2034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8189 -16.1877 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.0231 -16.4021 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.0085 -16.5634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2119 -16.3459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8087 -15.7900 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.5245 -15.0157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6969 -15.0157 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.2829 -15.7317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1881 -14.3664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3987 -14.5999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7970 -14.0305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9886 -13.2310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 0
3 4 2 0
3 5 1 0
5 6 1 0
5 7 1 0
7 8 1 0
9 8 2 0
10 9 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
16 15 1 0
16 17 1 0
17 18 1 0
17 19 2 0
17 20 2 0
15 21 2 0
21 22 1 0
22 12 2 0
23 10 2 0
24 23 1 0
7 24 2 0
25 24 1 0
25 26 1 0
27 25 1 0
2 27 2 0
27 28 1 0
29 28 2 0
30 29 1 0
1 30 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 424.49Molecular Weight (Monoisotopic): 424.1318AlogP: 2.95#Rotatable Bonds: 4Polar Surface Area: 107.53Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.13CX Basic pKa: 3.82CX LogP: 1.78CX LogD: 1.78Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.66Np Likeness Score: -1.20
References 1. Ferguson FM, Liu Y, Harshbarger W, Huang L, Wang J, Deng X, Capuzzi SJ, Muratov EN, Tropsha A, Muthuswamy S, Westover KD, Gray NS.. (2020) Synthesis and Structure-Activity Relationships of DCLK1 Kinase Inhibitors Based on a 5,11-Dihydro-6H -benzo[e ]pyrimido[5,4-b ][1,4]diazepin-6-one Scaffold., 63 (14): [PMID:32530623 ] [10.1021/acs.jmedchem.0c00596 ]