Rhodocorane F; 2-dehydroxyrhodocorane A

ID: ALA4646500

PubChem CID: 156019355

Max Phase: Preclinical

Molecular Formula: C15H20O4

Molecular Weight: 264.32

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cc([C@]23OC[C@@H](C)[C@H]2CC[C@H]3C)oc(=O)c1O

Standard InChI:  InChI=1S/C15H20O4/c1-8-6-12(19-14(17)13(8)16)15-10(3)4-5-11(15)9(2)7-18-15/h6,9-11,16H,4-5,7H2,1-3H3/t9-,10-,11-,15-/m1/s1

Standard InChI Key:  NXASRCLLNRHDMV-UYUMYWFVSA-N

Molfile:  

 
     RDKit          2D

 20 22  0  0  0  0  0  0  0  0999 V2000
    3.2277   -6.7881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2916   -5.4594    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7801   -6.1006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0597   -5.7533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0234   -6.5734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7923   -6.8601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3054   -6.2171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8510   -5.5317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3472   -3.7021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3472   -4.5234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0566   -4.9320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7660   -4.5234    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7660   -3.7021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0566   -3.2894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9376   -7.5562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0158   -7.3919    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.1419   -4.7664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6342   -3.2956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0566   -2.4681    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4790   -3.2956    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  5  1  0
  4  2  1  0
  2  3  1  0
  3  1  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  4  1  0
  9 10  1  0
  9 14  2  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
  4 11  1  1
  1 15  1  6
  5 16  1  1
  8 17  1  6
  9 18  1  0
 14 19  1  0
 13 20  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4646500

    ---

Associated Targets(non-human)

Rhodotorula glutinis (200 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 264.32Molecular Weight (Monoisotopic): 264.1362AlogP: 2.56#Rotatable Bonds: 1
Polar Surface Area: 59.67Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 10.45CX Basic pKa: CX LogP: 2.44CX LogD: 2.44
Aromatic Rings: 1Heavy Atoms: 19QED Weighted: 0.85Np Likeness Score: 1.81

References

1. Sandargo B, Michehl M, Stadler M, Surup F..  (2020)  Antifungal Sesquiterpenoids, Rhodocoranes, from Submerged Cultures of the Wrinkled Peach Mushroom, Rhodotus palmatus.,  83  (3): [PMID:31820970] [10.1021/acs.jnatprod.9b00871]

Source