2-[6-amino-4-(trifluoromethyl)-3-pyridyl]-N,N-diethyl-4-morpholino-pyrrolo[2,1-f][1,2,4]triazine-6-carboxamide

ID: ALA4646573

PubChem CID: 156019685

Max Phase: Preclinical

Molecular Formula: C21H24F3N7O2

Molecular Weight: 463.46

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCN(CC)C(=O)c1cc2c(N3CCOCC3)nc(-c3cnc(N)cc3C(F)(F)F)nn2c1

Standard InChI:  InChI=1S/C21H24F3N7O2/c1-3-29(4-2)20(32)13-9-16-19(30-5-7-33-8-6-30)27-18(28-31(16)12-13)14-11-26-17(25)10-15(14)21(22,23)24/h9-12H,3-8H2,1-2H3,(H2,25,26)

Standard InChI Key:  SRLJNLWAHPRZNG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   17.1624   -5.5359    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.8746   -5.1246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5829   -5.5354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5829   -6.3589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8771   -6.7655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1624   -6.3601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4553   -6.7689    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.2941   -6.7678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0013   -6.3589    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   19.2941   -7.5856    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   20.0013   -7.1767    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   19.2951   -5.1236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2954   -4.3040    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.0051   -3.8949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7176   -4.3028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7198   -5.1206    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.0116   -5.5379    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.4977   -5.3751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9740   -4.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4941   -4.0523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7917   -4.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2006   -4.0012    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.0183   -4.0012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4272   -3.2940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7917   -3.2940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2006   -2.5869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2006   -5.4196    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.0051   -3.0772    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.2980   -2.6683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2980   -1.8506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0051   -1.4417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.7122   -1.8506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7122   -2.6683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  6  7  1  0
  4  8  1  0
  8  9  1  0
  8 10  1  0
  8 11  1  0
 12  3  1  0
 13 12  1  0
 14 13  2  0
 15 14  1  0
 16 15  1  0
 17 16  1  0
 12 17  2  0
 16 18  1  0
 19 18  2  0
 20 19  1  0
 15 20  2  0
 19 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 22 25  1  0
 25 26  1  0
 21 27  2  0
 14 28  1  0
 29 28  1  0
 30 29  1  0
 31 30  1  0
 32 31  1  0
 33 32  1  0
 28 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4646573

    ---

Associated Targets(Human)

SJRH30 (203 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 463.46Molecular Weight (Monoisotopic): 463.1944AlogP: 2.71#Rotatable Bonds: 5
Polar Surface Area: 101.88Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 5.11CX LogP: 3.26CX LogD: 3.26
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.62Np Likeness Score: -1.51

References

1. Xiang HY, Chen YH, Wang Y, Zhang X, Ding J, Meng LH, Yang CH..  (2020)  Design, synthesis and antiproliferative activity evaluation of a series of pyrrolo[2,1-f][1,2,4]triazine derivatives.,  30  (12): [PMID:32317209] [10.1016/j.bmcl.2020.127194]

Source