The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-methyl-N-(1-(2-((1-methyl-1H-pyrazol-5-yl)amino)benzoyl)piperidin-4-yl)-4-acetyl-benzamide ID: ALA4646599
PubChem CID: 156019808
Max Phase: Preclinical
Molecular Formula: C26H29N5O3
Molecular Weight: 459.55
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)c1ccc(C(=O)N(C)C2CCN(C(=O)c3ccccc3Nc3ccnn3C)CC2)cc1
Standard InChI: InChI=1S/C26H29N5O3/c1-18(32)19-8-10-20(11-9-19)25(33)29(2)21-13-16-31(17-14-21)26(34)22-6-4-5-7-23(22)28-24-12-15-27-30(24)3/h4-12,15,21,28H,13-14,16-17H2,1-3H3
Standard InChI Key: ZURYVCJOLFOBMS-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
17.5819 -11.2316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3974 -11.2328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8043 -10.5283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3969 -9.8222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5784 -9.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1751 -10.5301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1735 -11.9394 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.3563 -11.9396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8054 -11.9408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3962 -12.6482 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.6226 -11.9414 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.0270 -12.6509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8406 -12.6535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2536 -11.9480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8468 -11.2381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0270 -11.2338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8727 -11.2811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0955 -11.5338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0957 -12.3511 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.8730 -12.6033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.1252 -13.3806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0708 -11.9517 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.4761 -12.6613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4826 -11.2459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0643 -13.3671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2933 -12.6650 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.2492 -13.3605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8374 -14.0655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2428 -14.7760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0643 -14.7771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4723 -14.0715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8320 -15.4824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0148 -15.4797 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.2383 -16.1914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 1 0
7 8 1 0
2 9 1 0
9 10 2 0
9 11 1 0
11 12 1 0
11 16 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
8 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 8 1 0
20 21 1 0
14 22 1 0
22 23 1 0
22 24 1 0
23 25 1 0
23 26 2 0
25 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 25 1 0
29 32 1 0
32 33 2 0
32 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 459.55Molecular Weight (Monoisotopic): 459.2270AlogP: 3.74#Rotatable Bonds: 6Polar Surface Area: 87.54Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 3.26CX LogP: 3.19CX LogD: 3.19Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.57Np Likeness Score: -1.69
References 1. Ji D, Zhang W, Xu Y, Zhang JJ.. (2020) Design, synthesis and biological evaluation of anthranilamide derivatives as potent SMO inhibitors., 28 (6): [PMID:32063403 ] [10.1016/j.bmc.2020.115354 ]