The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Methyl 12-anabsinthinate ID: ALA4646849
PubChem CID: 156020792
Max Phase: Preclinical
Molecular Formula: C31H42O6
Molecular Weight: 510.67
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)[C@@H](C)C1=CC2=C(C)[C@H]3[C@H]([C@@H]4CC5(C)O[C@@]6(C)CC[C@H]7[C@H](C)C(=O)O[C@@H]7C35[C@@H]46)[C@H]2[C@@](C)(O)CC1
Standard InChI: InChI=1S/C31H42O6/c1-14(26(32)35-7)17-8-10-28(4,34)23-19(12-17)15(2)22-21(23)20-13-30(6)31(22)24(20)29(5,37-30)11-9-18-16(3)27(33)36-25(18)31/h12,14,16,18,20-25,34H,8-11,13H2,1-7H3/t14-,16-,18-,20-,21-,22-,23-,24-,25-,28-,29-,30?,31?/m0/s1
Standard InChI Key: LRITZRIJFAZEOT-IZIVKRLGSA-N
Molfile:
RDKit 2D
44 50 0 0 0 0 0 0 0 0999 V2000
3.1927 -15.3846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9991 -16.1903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5072 -16.8459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3355 -16.8459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8585 -16.2142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6808 -15.4084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9349 -15.0399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6781 -16.2927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3903 -14.9873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0098 -15.5353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7192 -15.1142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7181 -14.2299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5378 -14.3127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4587 -15.4758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1981 -15.1155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3912 -14.3214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8806 -13.6822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0557 -13.6758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5743 -16.2923 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7697 -15.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3844 -16.4370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7969 -17.1516 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5674 -15.4981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3485 -14.3234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5236 -14.3234 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0906 -17.0072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9127 -14.7040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0557 -12.8486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0231 -15.1155 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5.1758 -14.1935 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.2794 -13.6890 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.8753 -16.0591 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
4.6808 -14.5834 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5.5077 -13.4363 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.4016 -16.3405 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.9851 -14.6876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6340 -14.4054 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6567 -14.8289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0947 -17.5563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5072 -18.2708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2697 -17.5563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3322 -18.2708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0947 -18.9894 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7446 -18.9894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
5 4 1 0
6 5 1 0
7 6 1 0
1 7 1 0
5 8 2 0
6 9 1 0
9 10 1 0
10 8 1 0
10 11 1 0
9 12 1 0
12 13 1 0
13 11 1 0
11 14 1 0
14 15 1 0
16 15 1 0
17 16 1 0
18 17 1 0
13 18 1 0
14 19 1 0
15 20 1 0
20 21 1 0
21 19 1 0
21 22 2 0
20 23 1 6
7 24 1 1
7 25 1 0
8 26 1 0
12 27 1 0
18 28 1 0
18 37 1 1
15 29 1 6
9 30 1 6
13 31 1 6
14 32 1 1
6 33 1 1
12 34 1 6
10 35 1 6
27 36 1 0
11 36 1 0
36 37 1 0
36 38 1 0
3 39 1 0
39 40 1 0
39 41 1 1
40 42 1 0
40 43 2 0
42 44 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 510.67Molecular Weight (Monoisotopic): 510.2981AlogP: 4.60#Rotatable Bonds: 2Polar Surface Area: 82.06Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 2.94CX LogD: 2.94Aromatic Rings: ┄Heavy Atoms: 37QED Weighted: 0.55Np Likeness Score: 2.65
References 1. Talmon M, Bosso L, Quaregna M, Lopatriello A, Rossi S, Gavioli D, Marotta P, Caprioglio D, Boldorini R, Miggiano R, Fresu LG, Pollastro F.. (2020) Anti-inflammatory Activity of Absinthin and Derivatives in Human Bronchoepithelial Cells., 83 (6): [PMID:32496797 ] [10.1021/acs.jnatprod.9b00685 ]