The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-[(5-isopropyl-11-methyl-6-oxo-pyrimido[4,5-b][1,4]benzodiazepin-2-yl)amino]-3-methoxy-N-(1-methyl-4-piperidyl)benzamide ID: ALA4646882
PubChem CID: 134457696
Max Phase: Preclinical
Molecular Formula: C29H35N7O3
Molecular Weight: 529.65
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(C(=O)NC2CCN(C)CC2)ccc1Nc1ncc2c(n1)N(C)c1ccccc1C(=O)N2C(C)C
Standard InChI: InChI=1S/C29H35N7O3/c1-18(2)36-24-17-30-29(33-26(24)35(4)23-9-7-6-8-21(23)28(36)38)32-22-11-10-19(16-25(22)39-5)27(37)31-20-12-14-34(3)15-13-20/h6-11,16-18,20H,12-15H2,1-5H3,(H,31,37)(H,30,32,33)
Standard InChI Key: ZQUIUVSYHRHZHW-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
4.5186 -14.6171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1209 -15.1867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8633 -14.8422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8633 -14.0165 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6052 -15.2067 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.1894 -14.6225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9758 -13.8246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9874 -14.8361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7848 -16.0092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5887 -16.1460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8720 -16.9134 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.3571 -17.5411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5708 -18.3390 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3645 -18.5527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5795 -19.3513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3786 -19.5582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9570 -18.9807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7550 -19.1944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9686 -19.9882 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.7666 -20.2018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3466 -19.6176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1445 -19.8313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3582 -20.6292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.7740 -21.2135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9761 -20.9998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1561 -20.8429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3392 -18.6102 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7433 -18.1825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9491 -17.9687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7354 -17.1707 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3196 -16.5865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5491 -17.4074 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2641 -16.6398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4389 -16.6398 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0240 -17.3531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9291 -15.9891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1380 -16.2231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5391 -15.6566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7311 -14.8554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 0
3 4 2 0
3 5 1 0
5 6 1 0
6 7 1 0
6 8 1 0
5 9 1 0
9 10 1 0
11 10 2 0
12 11 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
21 20 1 0
22 21 1 0
23 22 1 0
24 23 1 0
25 24 1 0
20 25 1 0
23 26 1 0
27 18 2 0
17 28 2 0
28 29 1 0
29 14 2 0
29 30 1 0
30 31 1 0
32 12 2 0
33 32 1 0
9 33 2 0
34 33 1 0
34 35 1 0
36 34 1 0
2 36 2 0
36 37 1 0
38 37 2 0
39 38 1 0
1 39 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 529.65Molecular Weight (Monoisotopic): 529.2801AlogP: 4.19#Rotatable Bonds: 6Polar Surface Area: 102.93Molecular Species: BASEHBA: 8HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.18CX Basic pKa: 8.57CX LogP: 3.13CX LogD: 1.93Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.49Np Likeness Score: -1.23
References 1. Ferguson FM, Liu Y, Harshbarger W, Huang L, Wang J, Deng X, Capuzzi SJ, Muratov EN, Tropsha A, Muthuswamy S, Westover KD, Gray NS.. (2020) Synthesis and Structure-Activity Relationships of DCLK1 Kinase Inhibitors Based on a 5,11-Dihydro-6H -benzo[e ]pyrimido[5,4-b ][1,4]diazepin-6-one Scaffold., 63 (14): [PMID:32530623 ] [10.1021/acs.jmedchem.0c00596 ]